CAS 35938-43-3

Pterosin C

Description:

Pterosin C is a naturally occurring chemical compound classified as a sesquiterpenoid, primarily derived from certain species of ferns, particularly those in the Pteridium genus. It is characterized by its complex bicyclic structure, which contributes to its biological activity. Pterosin C exhibits various pharmacological properties, including anti-inflammatory and potential anticancer effects, making it a subject of interest in medicinal chemistry and natural product research. The compound is known for its ability to interact with biological systems, potentially influencing cellular pathways. Its solubility properties typically align with those of other organic compounds, and it may exhibit moderate lipophilicity. Pterosin C is also notable for its role in traditional medicine, where it has been utilized for its therapeutic benefits. As with many natural products, the extraction and purification processes can be challenging, and ongoing research aims to elucidate its mechanisms of action and potential applications in drug development.

Formula: C₁₄H₁₈O₃

InChI: InChI=1S/C14H18O3/c1-7-6-11-12(8(2)10(7)4-5-15)14(17)9(3)13(11)16/h6,9,13,15-16H,4-5H2,1-3H3/t9-,13-/m0/s1

InChI key: InChIKey=QQPCNRKHGFIVLH-ZANVPECISA-N

SMILES: O[C@@H]1C=2C(=C(C)C(CCO)=C(C)C2)C(=O)[C@H]1C

Synonyms:

• (2S,3S)-2,3-Dihydro-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one
• (2S,3S)-3-Hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1-indanone
• (2S,3S)-Pterosin C
• 1H-Inden-1-one, 2,3-dihydro-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-, (2S-trans)-
• 1H-inden-1-one, 2,3-dihydro-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-, (2S,3S)-
• Pterosin C

Pterosin C

CAS: 35938-43-3

Formula: C₁₄H₁₈O₃

Purity: 95%~99%

Molecular weight: 234.295

Ref: BP-SBP03688

Pterosin C

CAS: 35938-43-3

Pterosin C is a sesquiterpenoid compound, which is predominantly derived from the Pteridium species of ferns. These naturally occurring substances are biosynthesized in the plants and are part of the large family of terpenoids that often play crucial roles in plant defense mechanisms. Pterosin C operates through mechanisms that include modulating various molecular targets and pathways, such as inhibiting inflammation-related processes and possessing antioxidative properties.

Formula: C₁₄H₁₈O₃

Purity: Min. 95%

Molecular weight: 234.29 g/mol

Ref: 3D-KBA93843