CAS 359435-41-9

1-ethyl-5-pyridin-3-ylpyrrolidin-2-one

Description:

1-Ethyl-5-pyridin-3-ylpyrrolidin-2-one, with the CAS number 359435-41-9, is a chemical compound that belongs to the class of pyrrolidinones, which are cyclic amides derived from pyrrolidine. This substance features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the ethyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest that it could interact with biological targets, possibly affecting neurotransmitter systems or other cellular pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and solvent. Safety data and handling precautions should be considered when working with this compound, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1/C11H14N2O/c1-2-13-10(5-6-11(13)14)9-4-3-7-12-8-9/h3-4,7-8,10H,2,5-6H2,1H3

SMILES: CCN1C(CCC1=O)c1cccnc1

(R,S)-N-Ethyl Norcotinine

Controlled Product

CAS: 359435-41-9

Stability Very Hygroscopic
Applications (R,S)-N-Ethyl Norcotinine (cas# 359435-41-9) is a compound useful in organic synthesis.

Formula: C₁₁H₁₄N₂O

Color and Shape: Neat

Molecular weight: 190.24

Ref: TR-E925200

(R,S)-N-Ethyl Norcotinine

CAS: 359435-41-9

Formula: C₁₁H₁₄N₂O

Ref: TR-TRC-E925200