CAS 359435-46-4
:N,N′-1,6-Hexanediylbis[3-(2-pyridinyldithio)propanamide]
Description:
N,N′-1,6-Hexanediylbis[3-(2-pyridinyldithio)propanamide] is a chemical compound characterized by its unique structure, which includes a hexanediyl linker and two 3-(2-pyridinyldithio)propanamide moieties. This compound features a central hexane chain that connects two functional groups, each containing a pyridine ring substituted with a dithio group, which enhances its potential for coordination with metal ions and may exhibit chelating properties. The presence of the amide functional groups contributes to its solubility in polar solvents and may influence its reactivity and interaction with biological systems. Additionally, the pyridine rings can participate in various chemical reactions, making this compound of interest in fields such as coordination chemistry and materials science. Its specific applications may include use in drug delivery systems, sensors, or as a ligand in metal complexation. Overall, the compound's structural characteristics suggest potential utility in various chemical and biological applications, although detailed studies would be necessary to fully elucidate its properties and behaviors.
Formula:C22H30N4O2S4
InChI:InChI=1S/C22H30N4O2S4/c27-19(11-17-29-31-21-9-3-7-15-25-21)23-13-5-1-2-6-14-24-20(28)12-18-30-32-22-10-4-8-16-26-22/h3-4,7-10,15-16H,1-2,5-6,11-14,17-18H2,(H,23,27)(H,24,28)
InChI key:InChIKey=FSJMRAGUAKPKOU-UHFFFAOYSA-N
SMILES:S(SCCC(NCCCCCCNC(CCSSC1=CC=CC=N1)=O)=O)C2=CC=CC=N2
Synonyms:- N,N′-1,6-Hexanediylbis[3-(2-pyridinyldithio)propanamide]
- Propanamide, N,N′-1,6-hexanediylbis[3-(2-pyridinyldithio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,6-Hexane-bis-[3-(2-pyridyldithio)propionamide]
CAS:Controlled Product<p>Applications A sulfhydryl reactive protein crosslinking reagent. Dimeric adducts can be cleaved with TCEP.<br></p>Formula:C22H30N4O2S4Color and Shape:NeatMolecular weight:510.76
