
CAS 359436-61-6
:1H-Pyrrole-1-propanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide 2,2,2-trifluoroacetate (1:1)
Description:
1H-Pyrrole-1-propanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide 2,2,2-trifluoroacetate (1:1), with CAS number 359436-61-6, is a chemical compound characterized by its complex structure, which includes a pyrrole ring and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and pyrrole derivatives, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of functional groups. The trifluoroacetate moiety contributes to its solubility in organic solvents and may influence its biological activity. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the compound. Additionally, this substance may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various applications, including drug development and material science. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C7H9N3O3·C2HF3O2
InChI:InChI=1S/C7H9N3O3.C2HF3O2/c8-9-5(11)3-4-10-6(12)1-2-7(10)13;3-2(4,5)1(6)7/h1-2H,3-4,8H2,(H,9,11);(H,6,7)
InChI key:InChIKey=BADCXPKRBUEEMA-UHFFFAOYSA-N
SMILES:C(CC(NN)=O)N1C(=O)C=CC1=O.C(C(O)=O)(F)(F)F
Synonyms:- 1H-Pyrrole-1-propanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide, mono(trifluoroacetate)
- N-(β-Maleimidopropionic acid)hydrazide trifluoroacetate
- 1H-Pyrrole-1-propanoic acid, 2,5-dihydro-2,5-dioxo-, hydrazide 2,2,2-trifluoroacetate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Maleimidopropionic Acid Hydrazonium, Trifluoroacetate
CAS:Formula:C9H10F3N3O5Purity:95%Color and Shape:SolidMolecular weight:297.18803-Maleimidopropionic acid hydrazonium (trifluoroacetate)
CAS:3-Maleimidopropionic acid hydrazonium (trifluoroacetate)Purity:98%3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanehydrazide 2,2,2-trifluoroacetate
CAS:Purity:98%Molecular weight:297.19000243-Maleimidopropionic Acid Hydrazonium Trifluoroacetic Acid Salt
CAS:Controlled ProductApplications A water soluble, sulfhydryl and carbonyl reactive heterobifunctional crosslinking reagent.
References Kitagawa, T., et al.: Chem. Pharm. Bull., 29, 1130 (1981)Formula:C7H9N3O3·C2HF3O2Color and Shape:NeatMolecular weight:297.193-Maleimidopropionic acid hydrazonium trifluoroacetate
CAS:Please enquire for more information about 3-Maleimidopropionic acid hydrazonium trifluoroacetate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C7H9N3O3·CHF3CO2Purity:Min. 95%Molecular weight:297.19 g/mol





