CymitQuimica logo

CAS 359436-85-4

:

ethyl 4-hydroxy-1-[(4-methoxyphenyl)methyl]-5-oxo-2-(3-pyridyl)-2H-pyrrole-3-carboxylate

Description:
Ethyl 4-hydroxy-1-[(4-methoxyphenyl)methyl]-5-oxo-2-(3-pyridyl)-2H-pyrrole-3-carboxylate, with the CAS number 359436-85-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring, a carboxylate group, and various aromatic substituents. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of functional groups like the hydroxyl and methoxy groups suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Additionally, the pyridine moiety may contribute to its pharmacological properties, potentially enhancing its interaction with biological targets. Overall, this compound's unique structure and functional groups position it as a candidate for further research in therapeutic applications, particularly in the fields of anti-inflammatory or anticancer agents.
Formula:C20H20N2O5
InChI:InChI=1/C20H20N2O5/c1-3-27-20(25)16-17(14-5-4-10-21-11-14)22(19(24)18(16)23)12-13-6-8-15(26-2)9-7-13/h4-11,17,23H,3,12H2,1-2H3
SMILES:CCOC(=O)C1=C(C(=O)N(Cc2ccc(cc2)OC)C1c1cccnc1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.