CAS 359436-89-8
:N-(7-methoxycoumarin-4-acetyloxy)succinimide
Description:
N-(7-methoxycoumarin-4-acetyloxy)succinimide is a chemical compound characterized by its unique structure, which combines a coumarin moiety with a succinimide functional group. This compound typically exhibits properties associated with both coumarins and succinimides, including potential fluorescence due to the coumarin structure, which is known for its light-absorbing and emitting capabilities. The presence of the methoxy group enhances its solubility in organic solvents, while the acetyloxy group may influence its reactivity and stability. This compound is often utilized in biochemical applications, particularly in the development of fluorescent probes or as a reagent in organic synthesis. Its specific interactions and reactivity can be influenced by environmental factors such as pH and solvent polarity. Overall, N-(7-methoxycoumarin-4-acetyloxy)succinimide represents a versatile compound with applications in research and industry, particularly in fields related to biochemistry and materials science.
Formula:C16H13NO7
InChI:InChI=1/C16H13NO7/c1-22-10-2-3-11-9(6-15(20)23-12(11)8-10)7-16(21)24-17-13(18)4-5-14(17)19/h2-3,6,8H,4-5,7H2,1H3
SMILES:COc1ccc2c(cc(=O)oc2c1)CC(=O)ON1C(=O)CCC1=O
Synonyms:- 1-{[(7-methoxy-2-oxo-2H-chromen-4-yl)acetyl]oxy}pyrrolidine-2,5-dione
- Mca-OSu
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,5-Dioxopyrrolidin-1-yl 2-(7-methoxy-2-oxo-2H-chromen-4-yl)acetate
CAS:Formula:C16H13NO7Purity:95%Color and Shape:SolidMolecular weight:331.2769MCA succinimidyl ester
CAS:<p>MCA succinimidyl ester, a derivative of MCA, selectively reacts with amines and serves as a peptide substrate for fluorescence resonance energy transfer (FRET</p>Formula:C16H13NO7Color and Shape:SolidMolecular weight:331.287-Methoxycoumarin-4-acetic acid N-succinimidyl ester
CAS:<p>7-Methoxycoumarin-4-acetic acid N-succinimidyl ester is a fluorescent probe for the detection of metalloproteinases. It has been used in assays to measure matrix metalloproteinase activity and to study the kinetics of these enzymes. This compound can be used as a fluorescence focus for the study of extracellular matrix regulation. 7-Methoxycoumarin-4-acetic acid N-succinimidyl ester inhibits matrix metalloproteinases by binding to their active site and blocking access to substrates, preventing the breakdown of extracellular matrix proteins.</p>Formula:C16H13NO7Purity:Min. 97 Area-%Color and Shape:Off-White PowderMolecular weight:331.28 g/mol7-Methoxycoumarin-4-acetic Acid N-Succinimidyl Ester
CAS:Controlled ProductFormula:C16H13NO7Color and Shape:NeatMolecular weight:331.28






