CAS 359437-02-8
:methyl (2S)-2-hydroxy-2-[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate
Description:
Methyl (2S)-2-hydroxy-2-[(4R,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate, with the CAS number 359437-02-8, is a chemical compound characterized by its complex structure, which includes a dioxolane ring and a hydroxymethyl group. This compound features a chiral center, contributing to its stereochemistry, which is significant in determining its biological activity and interactions. It is typically a colorless to pale yellow liquid, exhibiting solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of hydroxyl and ester functional groups suggests that it may participate in hydrogen bonding, influencing its reactivity and potential applications in organic synthesis or as an intermediate in pharmaceutical development. Its specific properties, such as boiling point, melting point, and density, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure and functional groups make it of interest in various chemical and biological contexts.
Formula:C9H16O6
InChI:InChI=1/C9H16O6/c1-9(2)14-5(4-10)7(15-9)6(11)8(12)13-3/h5-7,10-11H,4H2,1-3H3/t5-,6+,7+/m1/s1
Synonyms:- 3,4-O-(1-Methylethylidene)-D-lyxonic Acid Methyl Ester
- D-Lyxonic acid, 3,4-O-(1-methylethylidene)-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3,4-O-isopropylidene-D-lyxonate
CAS:Methyl 3,4-O-isopropylidene-D-lyxonate is a glycosylation product of L-xylose. It has been used in click chemistry as a fluorinated building block for the synthesis of polysaccharides and saccharides. Methyl 3,4-O-isopropylidene-D-lyxonate can be custom synthesized to any desired purity.Formula:C9H16O6Purity:Min. 95%Molecular weight:220.22 g/mol

