CAS 359446-04-1

N-(4-fluorobenzyl)-2-methylpropan-1-amine

Description:

N-(4-fluorobenzyl)-2-methylpropan-1-amine, with the CAS number 359446-04-1, is a chemical compound that belongs to the class of substituted amines. It features a propan-1-amine backbone with a 2-methyl group and a 4-fluorobenzyl substituent, which contributes to its unique properties. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the fluorobenzyl group may enhance lipophilicity, influencing its interaction with biological targets. Additionally, the amine functional group can participate in hydrogen bonding, affecting solubility and reactivity. The compound's structure suggests it may exhibit stimulant or psychoactive properties, similar to other amines, although specific biological effects would depend on further empirical studies. As with many organic compounds, safety and handling precautions are essential, as it may pose risks if ingested or improperly handled. Overall, N-(4-fluorobenzyl)-2-methylpropan-1-amine is of interest for its potential applications in research and development within the pharmaceutical industry.

Formula: C₁₁H₁₆FN

InChI: InChI=1/C11H16FN/c1-9(2)7-13-8-10-3-5-11(12)6-4-10/h3-6,9,13H,7-8H2,1-2H3

SMILES: CC(C)CNCc1ccc(cc1)F

[(4-fluorophenyl)methyl](2-methylpropyl)amine

CAS: 359446-04-1

Formula: C₁₁H₁₆FN

Purity: 95.0%

Molecular weight: 181.254

Ref: 10-F523313