CAS 35951-28-1: 2-Chlorocyclododecanone
Description:2-Chlorocyclododecanone is a cyclic ketone characterized by a twelve-membered carbon ring with a chlorine substituent at the second carbon position and a ketone functional group. Its molecular structure contributes to its unique chemical properties, including its potential as a building block in organic synthesis and its applications in the development of pharmaceuticals and agrochemicals. The presence of the chlorine atom introduces polarity, which can influence its reactivity and solubility in various solvents. Typically, compounds like 2-chlorocyclododecanone exhibit moderate volatility and may have distinct odor characteristics. The compound's reactivity can be attributed to the electrophilic nature of the carbonyl group, making it susceptible to nucleophilic attacks. Additionally, the cyclic structure can lead to interesting conformational dynamics, affecting its interactions with other molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 2-chlorocyclododecanone is a noteworthy compound in the realm of organic chemistry with diverse potential applications.
Formula:C12H21ClO
InChI:InChI=1S/C12H21ClO/c13-11-9-7-5-3-1-2-4-6-8-10-12(11)14/h11H,1-10H2
InChI key:InChIKey=VDNDILHUSVTMNI-UHFFFAOYSA-N
SMILES:O=C1CCCCCCCCCCC1Cl
- Synonyms:
- 2-Chloro-1-cyclododecanone
- 2-Chlorocyclododecane-1-one
- Cyclododecanone, 2-chloro-
- α-Chloro-1-cyclododecanone
- α-Chlorocyclododecanone
- 2-Chlorocyclododecanone
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Chlorocyclododecanone REF: 3B-C1650CAS: 35951-28-1 | >97.0%(GC) | 105.00 €~323.00 € | Thu 10 Apr 25 |
 | 2-CHLOROCYCLODODECANONE REF: IN-DA003H22CAS: 35951-28-1 | 97.0% | 129.00 €~316.00 € | Thu 17 Apr 25 |
 | 2-Chlorocyclododecan-1-one REF: 10-F755656CAS: 35951-28-1 | 97% | To inquire | Tue 29 Apr 25 |
 | 2-Chlorocyclododecanone REF: 3D-KBA95128CAS: 35951-28-1 | Min. 95% | - - - | Discontinued product |
2-Chlorocyclododecanone
Ref: 3B-C1650
| 1g | 105.00 € | ||
| 5g | 323.00 € |
2-CHLOROCYCLODODECANONE
Ref: IN-DA003H22
| 1g | 129.00 € | ||
| 5g | 316.00 € |
2-Chlorocyclododecanone
Ref: 3D-KBA95128
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
