CAS 35954-65-5

(3S,4S,5S,6S)-6-[4-(2-aminoethyl)-2-hydroxy-phenoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid

Description:

The chemical substance known as "(3S,4S,5S,6S)-6-[4-(2-aminoethyl)-2-hydroxy-phenoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid," with the CAS number 35954-65-5, is a complex organic compound characterized by its tetrahydropyran ring structure, which features multiple hydroxyl groups contributing to its hydrophilicity. The presence of a carboxylic acid functional group indicates acidic properties, while the aminoethyl and phenoxy substituents suggest potential for biological activity, possibly interacting with various biological targets. This compound is likely to exhibit solubility in polar solvents due to its multiple hydroxyl groups. Its stereochemistry, denoted by the (3S,4S,5S,6S) configuration, implies specific spatial arrangements that can influence its reactivity and interactions in biological systems. Such compounds are often of interest in medicinal chemistry and biochemistry, potentially serving as intermediates or active pharmaceutical ingredients. Overall, the unique structural features of this compound may confer specific properties that are valuable in research and therapeutic applications.

Formula: C₁₄H₁₉NO₈

InChI: InChI=1/C14H19NO8/c15-4-3-6-1-2-8(7(16)5-6)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h1-2,5,9-12,14,16-19H,3-4,15H2,(H,20,21)/t9-,10-,11-,12?,14+/m0/s1

2-Methyl-(3,4,6-tri-o-acetyl-1,2-dideoxy-α-d-glucopyrano)-[2,1-d]-2-oxazoline

CAS: 35954-65-5

Formula: C₁₄H₁₉NO₈

Purity: 95%

Color and Shape: Solid

Molecular weight: 329.3026

Ref: IN-DA00C9XV

FR054

CAS: 35954-65-5

FR054

Purity: ≥98%

Molecular weight: 329.3g/mol

Ref: 54-BUP16223

2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-∆2-oxazoline

CAS: 35954-65-5

2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-∆2-oxazoline

Color and Shape: Viscous Liquid

Molecular weight: 329.30g/mol

Ref: 54-BICL2389

FR054

CAS: 35954-65-5

FR054 inhibits PGM3, a key enzyme in the HBP, significantly reducing breast cancer cell growth and survival.

Formula: C₁₄H₁₉NO₈

Purity: ≥98%

Color and Shape: Solid

Molecular weight: 329.3

Ref: TM-T9468

2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-Δ2-oxazoline

CAS: 35954-65-5

Molecular weight: 329.30

Ref: 7W-GC4116

2-Methyl-(3,4,6-tri-O-acetyl-1,2-dideoxy-a-D-glucopyrano)-[2,1-d]-2-oxazoline

CAS: 35954-65-5

2-Methyl-(3,4,6-tri-O-acetyl-1,2-dideoxy-a-D-glucopyrano)-[2,1-d]-2-oxazoline (TAO) is a molecule that is produced during the glycosylation of proteins. TAO has been shown to enhance chemotherapy by targeting and inhibiting the growth of cancer cells. TAO binds to the epidermal growth factor receptor (EGFR), which is a protein that regulates cell proliferation. TAO inhibits cancer cell growth by blocking the activation of EGFR and its downstream signaling pathways. This inhibition leads to tumor regression in xenografts in mice. TAO also blocks o-glycosylation, which is a process that enhances cancer therapy resistance.

Formula: C₁₄H₁₉NO₈

Purity: 90%

Color and Shape: Yellow Powder

Molecular weight: 329.31 g/mol

Ref: 3D-MM07263

2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-alpha-D-glucopyrano)-delta2-oxazoline

Controlled Product

CAS: 35954-65-5

Formula: C₁₄H₁₉NO₈

Color and Shape: Neat

Molecular weight: 329.3

Ref: TR-M330818