CAS 35954-65-5
:(3S,4S,5S,6S)-6-[4-(2-aminoethyl)-2-hydroxy-phenoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance known as "(3S,4S,5S,6S)-6-[4-(2-aminoethyl)-2-hydroxy-phenoxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid," with the CAS number 35954-65-5, is a complex organic compound characterized by its tetrahydropyran ring structure, which features multiple hydroxyl groups contributing to its hydrophilicity. The presence of a carboxylic acid functional group indicates acidic properties, while the aminoethyl and phenoxy substituents suggest potential for biological activity, possibly interacting with various biological targets. This compound is likely to exhibit solubility in polar solvents due to its multiple hydroxyl groups. Its stereochemistry, denoted by the (3S,4S,5S,6S) configuration, implies specific spatial arrangements that can influence its reactivity and interactions in biological systems. Such compounds are often of interest in medicinal chemistry and biochemistry, potentially serving as intermediates or active pharmaceutical ingredients. Overall, the unique structural features of this compound may confer specific properties that are valuable in research and therapeutic applications.
Formula:C14H19NO8
InChI:InChI=1/C14H19NO8/c15-4-3-6-1-2-8(7(16)5-6)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h1-2,5,9-12,14,16-19H,3-4,15H2,(H,20,21)/t9-,10-,11-,12?,14+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Methyl-(3,4,6-tri-o-acetyl-1,2-dideoxy-α-d-glucopyrano)-[2,1-d]-2-oxazoline
CAS:Formula:C14H19NO8Purity:95%Color and Shape:SolidMolecular weight:329.30262-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-∆2-oxazoline
CAS:2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-∆2-oxazolineColor and Shape:Viscous LiquidMolecular weight:329.30g/molFR054
CAS:FR054 inhibits PGM3, a key enzyme in the HBP, significantly reducing breast cancer cell growth and survival.Formula:C14H19NO8Purity:≥98%Color and Shape:SolidMolecular weight:329.32-Methyl-(3,4,6-tri-O-acetyl-1,2-dideoxy-a-D-glucopyrano)-[2,1-d]-2-oxazoline
CAS:2-Methyl-(3,4,6-tri-O-acetyl-1,2-dideoxy-a-D-glucopyrano)-[2,1-d]-2-oxazoline (TAO) is a molecule that is produced during the glycosylation of proteins. TAO has been shown to enhance chemotherapy by targeting and inhibiting the growth of cancer cells. TAO binds to the epidermal growth factor receptor (EGFR), which is a protein that regulates cell proliferation. TAO inhibits cancer cell growth by blocking the activation of EGFR and its downstream signaling pathways. This inhibition leads to tumor regression in xenografts in mice. TAO also blocks o-glycosylation, which is a process that enhances cancer therapy resistance.Formula:C14H19NO8Purity:90%Color and Shape:Yellow PowderMolecular weight:329.31 g/mol2-Methyl-4,5-(3,4,6-tri-O-acetyl-2-deoxy-α-D-glucopyrano)-∆2-oxazoline
CAS:Controlled ProductFormula:C14H19NO8Color and Shape:NeatMolecular weight:329.3





