CAS 359586-67-7
:Ethyl (1R,2R)-2-[[(1S)-1-phenylethyl]amino]cyclopentanecarboxylate
Description:
Ethyl (1R,2R)-2-[[(1S)-1-phenylethyl]amino]cyclopentanecarboxylate, with CAS number 359586-67-7, is a chemical compound characterized by its complex structure, which includes a cyclopentane ring, an ethyl ester functional group, and an amino group attached to a phenylethyl moiety. This compound exhibits chirality, with specific stereochemistry at multiple centers, contributing to its potential biological activity. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its ester functionality. The presence of the amino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis may involve multi-step organic reactions, including amination and esterification processes. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental conditions such as temperature and pH. Overall, this compound represents a class of molecules that may have implications in drug development and pharmacology, warranting further investigation into its properties and effects.
Formula:C16H23NO2
InChI:InChI=1S/C16H23NO2/c1-3-19-16(18)14-10-7-11-15(14)17-12(2)13-8-5-4-6-9-13/h4-6,8-9,12,14-15,17H,3,7,10-11H2,1-2H3/t12-,14+,15+/m0/s1
InChI key:InChIKey=XFESHQNKLZLTHP-NWANDNLSSA-N
SMILES:C(OCC)(=O)[C@H]1[C@H](N[C@@H](C)C2=CC=CC=C2)CCC1
Synonyms:- Cyclopentanecarboxylic acid, 2-[[(1S)-1-phenylethyl]amino]-, ethyl ester, (1R,2R)-
- Ethyl (1R,2R)-2-[[(1S)-1-phenylethyl]amino]cyclopentanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl (1R,2R)-2-[[(S)-1-phenylethyl]amino]cyclopentanecarboxylate
CAS:Formula:C16H23NO2Molecular weight:261.3593Ethyl (1R,2R)-2-[[(S)-1-Phenylethyl]amino]cyclopentanecarboxylate
CAS:Ethyl (1R,2R)-2-[[(S)-1-Phenylethyl]amino]cyclopentanecarboxylate
Molecular weight:261.36g/mol

