CAS 35959-37-6

5'-azido-2',5'-dideoxyuridine

Description:

5'-Azido-2',5'-dideoxyuridine (CAS 35959-37-6) is a nucleoside analog characterized by the presence of an azido group at the 5' position and the absence of hydroxyl groups at the 2' and 3' positions of the sugar moiety. This structural modification imparts unique properties, making it a valuable compound in molecular biology and medicinal chemistry. The azido group can participate in various chemical reactions, including click chemistry, which allows for the conjugation of biomolecules. As a dideoxynucleoside, it is unable to participate in further polymerization, making it useful in studies of DNA synthesis and as a potential antiviral agent. Its mechanism of action often involves the inhibition of viral reverse transcriptase, which is crucial for the replication of certain viruses. Additionally, 5'-azido-2',5'-dideoxyuridine can be utilized in labeling and tracking nucleic acids in research applications. Overall, its unique chemical structure and reactivity make it a significant compound in both research and therapeutic contexts.

Formula: C₉H₁₁N₅O₄

InChI: InChI=1/C9H11N5O4/c10-13-11-4-6-5(15)3-8(18-6)14-2-1-7(16)12-9(14)17/h1-2,5-6,8,15H,3-4H2,(H,12,16,17)/t5-,6+,8+/m0/s1

Synonyms:

• Uridine, 5'-azido-2',5'-dideoxy-
• 5'-Azido-2',5'-dideoxyuridine

5'-Azido-2',5'-dideoxyuridine

CAS: 35959-37-6

5'-Azido-2',5'-dideoxyuridine is a Nucleoside Derivative - 5'-Modified nucleoside, Azido-nucleoside.

Formula: C₉H₁₁N₅O₄

Color and Shape: Solid

Molecular weight: 253.22

Ref: TM-TNU1152

5’-Azido-2’,5’-dideoxyuridine

CAS: 35959-37-6

5’-Azido-2’,5’-dideoxyuridine (5ADU) is a pyrimidine nucleoside that has been used to treat cancer. It is converted to 5-azidouracil which inhibits the synthesis of thymidylate, an essential component of DNA. 5ADU is also active against herpes virus and can be used as an antiviral agent. This drug has been shown to protect against radiation damage by inhibiting the formation of free radicals. The protonation of 5ADU leads to a stereochemical rearrangement that prevents the formation of free radicals. 5ADU does not inhibit bacterial enzymes, but it does have some effect on viruses, such as herpes virus, because they contain DNA or RNA similar to human cells.

Formula: C₉H₁₁N₅O₄

Purity: Min. 95%

Molecular weight: 253.21 g/mol

Ref: 3D-NA163034