CAS 35959-50-3
:2',5'-dideoxyuridine
Description:
2',5'-Dideoxyuridine (CAS 35959-50-3) is a nucleoside analog that plays a significant role in biochemical research and therapeutic applications. It is characterized by the absence of hydroxyl groups at the 2' and 5' positions of the ribose sugar, which distinguishes it from standard nucleosides. This structural modification imparts unique properties, such as the ability to inhibit viral replication, making it a candidate for antiviral therapies. 2',5'-Dideoxyuridine is particularly noted for its incorporation into DNA during replication, leading to chain termination. It exhibits low toxicity in comparison to other nucleoside analogs, which enhances its potential for clinical use. The compound is typically soluble in water and exhibits stability under physiological conditions, although it may be sensitive to extreme pH levels. Its mechanism of action primarily involves interference with DNA polymerase activity, thereby disrupting the synthesis of viral DNA. Overall, 2',5'-dideoxyuridine serves as a valuable tool in molecular biology and pharmacology, particularly in the context of antiviral drug development.
Formula:C9H12N2O4
InChI:InChI=1/C9H12N2O4/c1-5-6(12)4-8(15-5)11-3-2-7(13)10-9(11)14/h2-3,5-6,8,12H,4H2,1H3,(H,10,13,14)/t5-,6+,8-/m1/s1
Synonyms:- Uridine, 2',5'-Dideoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2',5'-Dideoxyuridine
CAS:2',5'-Dideoxyuridine is a Nucleoside Derivative - 5'-Modified nucleoside;5'-Deoxy nucleoside.Formula:C9H12N2O4Color and Shape:SolidMolecular weight:212.2Ref: TM-TNU1183
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire2',5'-Dideoxyuridine
CAS:Controlled ProductApplications 2',5'-Dideoxyuridine (cas# 35959-50-3) is a useful research chemical.
Formula:C9H12N2O4Color and Shape:NeatMolecular weight:212.22',5'-Dideoxyuridine
CAS:2',5'-Dideoxyuridine is a synthetic nucleoside analog derived from uridine, one of the four standard nucleosides found in RNA. It is chemically modified by the removal of hydroxyl (–OH) groups at the 2' and 5' positions of the sugar, altering its ability to participate in RNA or DNA chain formation.
Formula:C9H12N2O4Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:212.21 g/molRef: 3D-ND08409
Discontinued product



