CAS 35959-50-3

2',5'-dideoxyuridine

Description:

2',5'-Dideoxyuridine (CAS 35959-50-3) is a nucleoside analog that plays a significant role in biochemical research and therapeutic applications. It is characterized by the absence of hydroxyl groups at the 2' and 5' positions of the ribose sugar, which distinguishes it from standard nucleosides. This structural modification imparts unique properties, such as the ability to inhibit viral replication, making it a candidate for antiviral therapies. 2',5'-Dideoxyuridine is particularly noted for its incorporation into DNA during replication, leading to chain termination. It exhibits low toxicity in comparison to other nucleoside analogs, which enhances its potential for clinical use. The compound is typically soluble in water and exhibits stability under physiological conditions, although it may be sensitive to extreme pH levels. Its mechanism of action primarily involves interference with DNA polymerase activity, thereby disrupting the synthesis of viral DNA. Overall, 2',5'-dideoxyuridine serves as a valuable tool in molecular biology and pharmacology, particularly in the context of antiviral drug development.

Formula: C₉H₁₂N₂O₄

InChI: InChI=1/C9H12N2O4/c1-5-6(12)4-8(15-5)11-3-2-7(13)10-9(11)14/h2-3,5-6,8,12H,4H2,1H3,(H,10,13,14)/t5-,6+,8-/m1/s1

Synonyms:

• Uridine, 2',5'-Dideoxy-

2'',5''-Dideoxyuridine

CAS: 35959-50-3

Ref: 7W-GN6037

2',5'-Dideoxyuridine

CAS: 35959-50-3

2',5'-Dideoxyuridine is a Nucleoside Derivative - 5'-Modified nucleoside;5'-Deoxy nucleoside.

Formula: C₉H₁₂N₂O₄

Color and Shape: Solid

Molecular weight: 212.2

Ref: TM-TNU1183

2',5'-Dideoxyuridine

CAS: 35959-50-3

2',5'-Dideoxyuridine is a synthetic nucleoside analog derived from uridine, one of the four standard nucleosides found in RNA. It is chemically modified by the removal of hydroxyl (–OH) groups at the 2' and 5' positions of the sugar, altering its ability to participate in RNA or DNA chain formation.

Formula: C₉H₁₂N₂O₄

Purity: Min. 95%

Color and Shape: White To Off-White Solid

Molecular weight: 212.21 g/mol

Ref: 3D-ND08409

2',5'-Dideoxyuridine

Controlled Product

CAS: 35959-50-3

Applications 2',5'-Dideoxyuridine (cas# 35959-50-3) is a useful research chemical.

Formula: C₉H₁₂N₂O₄

Color and Shape: Neat

Molecular weight: 212.2

Ref: TR-D440928