CAS 35966-17-7
:4-Hydroxy-8-methylquinoline-3-carboxylic acid
Description:
4-Hydroxy-8-methylquinoline-3-carboxylic acid, with the CAS number 35966-17-7, is an organic compound that belongs to the class of quinoline derivatives. This compound features a quinoline backbone, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a hydroxyl group (-OH) at the 4-position and a carboxylic acid group (-COOH) at the 3-position contributes to its acidic properties and potential for hydrogen bonding. The methyl group at the 8-position enhances its lipophilicity, which can influence its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly for its potential as an antimicrobial or anti-inflammatory agent. Its structural characteristics allow for various chemical modifications, which can lead to the development of derivatives with enhanced properties. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-6-3-2-4-7-9(6)12-5-8(10(7)13)11(14)15/h2-5H,1H3,(H,12,13)(H,14,15)
SMILES:Cc1cccc2c1[nH]cc(c2=O)C(=O)O
Synonyms:- 8-Methyl-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Hydroxy-8-methylquinoline-3-carboxylic acid
CAS:<p>4-Hydroxy-8-methylquinoline-3-carboxylic acid</p>Purity:≥95%Molecular weight:203.19g/mol4-Hydroxy-8-methylquinoline-3-carboxylic acid
CAS:<p>4-Hydroxy-8-methylquinoline-3-carboxylic acid is a potent antibacterial compound that has been shown to have strong antibacterial activity against both gram-positive and gram-negative bacteria. 4-Hydroxy-8-methylquinoline-3-carboxylic acid has been shown to be active against several different types of bacteria, including Staphylococcus aureus, Streptococcus pneumoniae, Escherichia coli, Haemophilus influenzae, Neisseria gonorrhoeae, and Pseudomonas aeruginosa. It is also active against some antibiotic resistant strains of bacteria. 4HMQC is a quinoline derivative which is modified by the addition of a methyl group to one of the rings. This modification increases its potency because it makes the molecule more lipophilic and hydrophobic. The resulting molecule may also be used as a phase transfer catalyst or as an antimicrobial</p>Formula:C11H9NO3Purity:Min. 95%Molecular weight:203.2 g/mol



