CAS 35969-51-8
:2-(2-ethoxy-2-oxoethyl)pyridine-3-carboxylic acid
Description:
2-(2-Ethoxy-2-oxoethyl)pyridine-3-carboxylic acid, with the CAS number 35969-51-8, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidic properties, and an ethoxy group that enhances its solubility in organic solvents. The presence of the keto group (oxo) adjacent to the ethoxy moiety indicates potential reactivity, particularly in condensation reactions. The compound's structure suggests it may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions could involve hydrogen bonding due to the carboxylic acid, influencing its behavior in various chemical environments. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in synthetic applications or biological assays. Overall, this compound's unique structural features position it as a potentially valuable entity in organic synthesis and medicinal chemistry.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-2-15-9(12)6-8-7(10(13)14)4-3-5-11-8/h3-5H,2,6H2,1H3,(H,13,14)
SMILES:CCOC(=O)Cc1c(cccn1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:Formula:C10H11NO4Color and Shape:SolidMolecular weight:209.19862-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:2-(2-Ethoxy-2-oxoethyl)nicotinic acidFormula:C10H11NO4Purity:≥95%Color and Shape:SolidMolecular weight:209.20g/mol2-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:Formula:C10H11NO4Purity:97.0%Color and Shape:SolidMolecular weight:209.2012-(2-Ethoxy-2-oxoethyl)nicotinic acid
CAS:2-(2-Ethoxy-2-oxoethyl)nicotinic acid (EETN) belongs to the class of intramolecular reactions. It is a urethane that undergoes an intramolecular cyclization reaction with isocyanate and azide. The nucleophiles are then incorporated into the resulting azaindole ring, which can be cleaved by hydrolysis to release nicotinic acid or azaindole. EETN has been used as a target compound in the synthesis of various other compounds, such as nicotinic acid and azaindole.Formula:C10H11NO4Purity:Min. 95%Molecular weight:209.2 g/mol



