CAS 35969-75-6
:5-nitropyridine-2-carbaldehyde
Description:
5-Nitropyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a nitro group at the 5-position and an aldehyde functional group at the 2-position contributes to its reactivity and chemical properties. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The nitro group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and as a building block in the synthesis of more complex organic molecules. Additionally, 5-nitropyridine-2-carbaldehyde can serve as an intermediate in the production of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its nitro group, which can be toxic and potentially explosive under certain conditions.
Formula:C6H4N2O3
InChI:InChI=1/C6H4N2O3/c9-4-5-1-2-6(3-7-5)8(10)11/h1-4H
SMILES:c1cc(cnc1C=O)N(=O)=O
Synonyms:- 2-Pyridinecarboxaldehyde, 5-Nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-NITRO-6-PYRIDINECARBOXALDEHYDE
CAS:Formula:C6H4N2O3Purity:96%Color and Shape:SolidMolecular weight:152.1076Ref: IN-DA00CA9X
1g65.00€5g159.00€10g219.00€25g607.00€50gTo inquire100gTo inquire100mg34.00€250mg41.00€3-Nitro-6-pyridinecarboxaldehyde
CAS:3-Nitro-6-pyridinecarboxaldehydeFormula:C6H4N2O3Purity:98%Color and Shape: orange powderMolecular weight:152.11g/mol3-Nitro-6-pyridinecarboxaldehyde
CAS:3-Nitro-6-pyridinecarboxaldehyde is a colorless liquid that is soluble in water. It has a boiling point of 155 degrees Celsius, and it has a density of 1.03 grams per milliliter. This chemical reacts with metal ions to form nitro compounds. 3-Nitro-6-pyridinecarboxaldehyde has been used as an analytical reagent for the determination of benzenes and pyridines in organic solvents and gas chromatography calibration. The reactivity of this chemical is due to its pyridine ring, which can be used as a ligand or reagent.Formula:C6H4N2O3Purity:Min. 98%Color and Shape:PowderMolecular weight:152.11 g/mol5-Nitropyridine-2-carbaldehyde
CAS:Controlled ProductFormula:C6H4N2O3Color and Shape:NeatMolecular weight:152.108




