CAS 35979-00-1
:H-His-Tyr-OH
Description:
The chemical substance known as "H-His-Tyr-OH," with the CAS number 35979-00-1, is a peptide that consists of the amino acids histidine (His) and tyrosine (Tyr) linked together. This compound is characterized by its structure, which includes an N-terminal histidine residue and a C-terminal tyrosine residue, with a hydroxyl group (-OH) at the end. Peptides like H-His-Tyr-OH are often studied for their biological activity, as they can play roles in various physiological processes, including signaling pathways and enzyme functions. The presence of histidine contributes to the peptide's potential buffering capacity and its ability to participate in metal ion coordination, while tyrosine is known for its role in the synthesis of neurotransmitters and hormones. Additionally, the peptide's solubility and stability can be influenced by the specific conditions of its environment, such as pH and temperature. Overall, H-His-Tyr-OH is of interest in biochemical research and potential therapeutic applications.
Formula:C15H18N4O4
InChI:InChI=1/C15H18N4O4/c16-12(6-10-7-17-8-18-10)14(21)19-13(15(22)23)5-9-1-3-11(20)4-2-9/h1-4,7-8,12-13,20H,5-6,16H2,(H,17,18)(H,19,21)(H,22,23)
SMILES:c1cc(ccc1CC(C(=O)O)N=C(C(Cc1cnc[nH]1)N)O)O
Synonyms:- Histidyltyrosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-His-Tyr-OH
CAS:Bachem ID: 4001317.
Formula:C15H18N4O4Purity:> 97%Color and Shape:Light YellowMolecular weight:318.33(S)-2-((S)-2-Amino-3-(1H-imidazol-4-yl)propanamido)-3-(4-hydroxyphenyl)propanoic acid
CAS:(S)-2-((S)-2-Amino-3-(1H-imidazol-4-yl)propanamido)-3-(4-hydroxyphenyl)propanoic acidPurity:95%Molecular weight:318.33g/molH-His-Tyr-OH
CAS:H-His-Tyr-OH is a histidine-containing compound that has been synthesized and structurally characterized. H-His-Tyr-OH was shown to be a competitive inhibitor of the enzyme histidine decarboxylase in a rat liver microsomal preparation. The kinetic constants for the inhibition of the enzyme were determined, and the binding site on the enzyme was identified by molecular modeling. This study also showed that H-His-Tyr-OH binds to monoclonal antibodies with high affinity and specificity, which may be useful for therapy.Formula:C15H18N4O4Purity:Min. 95%Molecular weight:318.33 g/mol




