CAS 3598-68-3
:(3R)-3-(nitromethyl)-2-benzofuran-1(3H)-one
Description:
(3R)-3-(Nitromethyl)-2-benzofuran-1(3H)-one, with the CAS number 3598-68-3, is a chemical compound characterized by its unique structural features, including a benzofuran moiety and a nitromethyl group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the nitro group contributes to its reactivity, making it a useful intermediate in various chemical reactions. Additionally, the benzofuran structure imparts certain aromatic properties, which can influence its solubility and interaction with biological systems. The stereochemistry indicated by the (3R) designation suggests specific spatial arrangements of atoms, which can affect the compound's biological activity and interaction with enzymes or receptors. Overall, this compound's characteristics make it of interest in research and development, particularly in the fields of pharmaceuticals and agrochemicals. However, handling and usage should be approached with caution due to the potential hazards associated with nitro compounds.
Formula:C9H7NO4
InChI:InChI=1/C9H7NO4/c11-9-7-4-2-1-3-6(7)8(14-9)5-10(12)13/h1-4,8H,5H2/t8-/m0/s1
SMILES:c1ccc2c(c1)[C@H](CN(=O)=O)OC2=O
Synonyms:- 3-(Nitromethyl)-2-benzofuran-1(3H)-one ,95%
- 3-(nitromethyl)-3H-2-benzofuran-1-one
- 3-(NitroMethyl)isobenzofuran-1(3H)-one
- 3-(NITROMETHYL)-2-BENZOFURAN-1(3H)-ONE
- (3R)-3-(nitromethyl)-3H-isobenzofuran-1-one
- 1(3H)-Isobenzofuranone, 3-(nitromethyl)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
