CAS 359804-21-0
:2-pyrrolidin-2-yl-1,3-benzothiazole
Description:
2-Pyrrolidin-2-yl-1,3-benzothiazole is a chemical compound characterized by its unique structure, which combines a benzothiazole moiety with a pyrrolidine ring. This compound typically exhibits properties associated with both heterocyclic compounds and aromatic systems. The presence of the benzothiazole structure often imparts biological activity, making it of interest in medicinal chemistry for potential pharmaceutical applications. The pyrrolidine ring contributes to the compound's conformational flexibility, which can influence its interaction with biological targets. In terms of solubility, compounds of this nature may exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific substituents and functional groups present. Additionally, the compound may display specific reactivity patterns typical of both the benzothiazole and pyrrolidine functionalities, making it a candidate for further chemical modifications. Overall, 2-pyrrolidin-2-yl-1,3-benzothiazole represents a class of compounds that are valuable in research and development, particularly in the fields of pharmacology and organic synthesis.
Formula:C11H12N2S
InChI:InChI=1/C11H12N2S/c1-2-6-10-8(4-1)13-11(14-10)9-5-3-7-12-9/h1-2,4,6,9,12H,3,5,7H2
SMILES:c1ccc2c(c1)nc(C1CCCN1)s2
Synonyms:- Benzothiazole, 2-(2-Pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
