CAS 35982-93-5
:2-oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile
Description:
2-Oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile, with the CAS number 35982-93-5, is a heterocyclic organic compound characterized by its pyridine-like structure featuring a dihydropyridine ring. This compound typically exhibits a range of chemical properties due to the presence of both a carbonitrile group and a ketone functionality, which can influence its reactivity and interactions with other molecules. The phenyl group attached to the dihydropyridine ring contributes to its aromatic character, potentially enhancing its stability and affecting its solubility in various solvents. The presence of the carbonitrile group suggests that it may participate in nucleophilic reactions, while the ketone may engage in condensation reactions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its structural features allow for potential applications in the synthesis of pharmaceuticals or agrochemicals, as well as in the development of materials with specific electronic or optical properties. Overall, 2-oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile is a versatile compound with significant implications in various fields of chemistry.
Formula:C12H8N2O
InChI:InChI=1/C12H8N2O/c13-7-10-6-11(8-14-12(10)15)9-4-2-1-3-5-9/h1-6,8H,(H,14,15)
SMILES:c1ccc(cc1)c1cc(C#N)c(nc1)O
Synonyms:- 2-Hydroxy-5-phenylnicotinonitrile
- 3-Pyridinecarbonitrile, 2-Hydroxy-5-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile
CAS:<p>2-Oxo-5-phenyl-1,2-dihydropyridine-3-carbonitrile</p>Purity:techMolecular weight:196.20g/mol
