CAS 359821-44-6

2-Amino-1-(4-phenyl-1-piperazinyl)ethanone

Description:

2-Amino-1-(4-phenyl-1-piperazinyl)ethanone, with the CAS number 359821-44-6, is a chemical compound characterized by its structural features, which include an amino group and a piperazine ring substituted with a phenyl group. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity due to the amino group and reactivity due to the carbonyl functionality. It is often studied in the context of medicinal chemistry, particularly for its potential pharmacological applications, including effects on the central nervous system. The presence of the piperazine moiety suggests possible interactions with neurotransmitter receptors, making it of interest in the development of therapeutic agents. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Safety and handling considerations are essential, as with many organic compounds, to mitigate any risks associated with exposure. Overall, 2-Amino-1-(4-phenyl-1-piperazinyl)ethanone represents a significant structure in the exploration of new drug candidates.

Formula: C₁₂H₁₇N₃O

InChI: InChI=1S/C12H17N3O/c13-10-12(16)15-8-6-14(7-9-15)11-4-2-1-3-5-11/h1-5H,6-10,13H2

InChI key: InChIKey=ZIKLEKHJFFJJOZ-UHFFFAOYSA-N

SMILES: C(CN)(=O)N1CCN(CC1)C2=CC=CC=C2

Synonyms:

• 2-Amino-1-(4-phenylpiperazin-1-yl)ethan-1-one
• 2-Amino-1-(4-phenyl-1-piperazinyl)ethanone
• Ethanone, 2-amino-1-(4-phenyl-1-piperazinyl)-
• Piperazine, 1-(aminoacetyl)-4-phenyl-

2-Amino-1-(4-phenylpiperazin-1-yl)ethan-1-one

Controlled Product

CAS: 359821-44-6

Versatile small molecule scaffold

Formula: C₁₂H₁₇N₃O

Purity: Min. 95%

Molecular weight: 219.28 g/mol

Ref: 3D-JPA82144