CAS 359878-47-0

N-(4-fluorobenzyl)-1-methylpiperidin-4-amine

Description:

N-(4-fluorobenzyl)-1-methylpiperidin-4-amine is a chemical compound characterized by its piperidine structure, which includes a nitrogen atom within a six-membered ring. The presence of a 4-fluorobenzyl group indicates that a fluorine atom is substituted on the benzene ring at the para position, contributing to the compound's unique properties. This compound is typically classified as an amine due to the presence of the amine functional group (-NH2) attached to the piperidine ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a point of interest in drug design. Additionally, the compound's solubility, reactivity, and interaction with biological targets would depend on its specific molecular interactions, which are influenced by the functional groups present. Overall, N-(4-fluorobenzyl)-1-methylpiperidin-4-amine represents a class of compounds that may have significant implications in therapeutic applications.

Formula: C₁₃H₁₉FN₂

InChI: InChI=1/C13H19FN2/c1-16-8-6-13(7-9-16)15-10-11-2-4-12(14)5-3-11/h2-5,13,15H,6-10H2,1H3

SMILES: CN1CCC(CC1)NCc1ccc(cc1)F

Synonyms:

• N-[(4-Fluorophenyl)methyl]-1-methyl-4-piperidinamine
• 4-(4-Fluorobenzylamino)-1-methylpiperidine
• N-(4-flurobenzyl)-1-methylpiperidin-4-Amine

4-(4-Fluorobenzylamino)-1-methylpiperidine

CAS: 359878-47-0

Formula: C₁₃H₁₉FN₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 222.3018

Ref: IN-DA0039TT

4-(4-Fluorobenzylamino)-1-methylpiperidine

CAS: 359878-47-0

4-(4-Fluorobenzylamino)-1-methylpiperidine

Purity: 98%

Molecular weight: 222.30g/mol

Ref: 54-PC101713

4-(4-Fluorobenzylamino)-1-methylpiperidine

CAS: 359878-47-0

Purity: 96%

Color and Shape: Liquid, Oil

Molecular weight: 222.3070068

Ref: 10-F790331

N-[(4-Fluorophenyl)methyl]-1-methyl-4-piperidinamine

Controlled Product

CAS: 359878-47-0

Applications N-[(4-Fluorophenyl)methyl]-1-methyl-4-piperidinamine is used as a reactant in the synthesis of Pimavanserin.
References Wan, Yongqing, et al.: Faming Zhuanli Shenqing, CN 106588753 A 20170426 (2017)

Formula: C₁₃H₁₉FN₂

Color and Shape: Neat

Molecular weight: 222.3

Ref: TR-F621745