CAS 359880-05-0: N-Cyclobutyl-4-piperidone

Description:N-Cyclobutyl-4-piperidone is a chemical compound characterized by its piperidone structure, which includes a piperidine ring with a ketone functional group at the fourth position and a cyclobutyl substituent at the nitrogen atom. This compound typically exhibits properties associated with cyclic amines, such as moderate polarity and the ability to participate in hydrogen bonding due to the presence of the carbonyl group. It is often used in organic synthesis and medicinal chemistry, potentially serving as an intermediate in the production of various pharmaceuticals. The presence of the cyclobutyl group may influence its steric and electronic properties, affecting its reactivity and interaction with biological targets. Additionally, N-Cyclobutyl-4-piperidone may exhibit specific solubility characteristics, making it suitable for various applications in chemical research and development. As with many chemical substances, safety and handling precautions should be observed, given its potential biological activity and the need for proper storage conditions to maintain stability.

Formula:C₉H₁₅NO

InChI:InChI=1/C9H15NO/c11-9-4-6-10(7-5-9)8-2-1-3-8/h8H,1-7H2

Synonyms:
1-Cyclobutylpiperidin-4-one
4-Piperidinone, 1-Cyclobutyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1-Cyclobutylpiperidin-4-one REF: 10-F773310CAS: 359880-05-0	98%	782.00 €	Thu 03 Apr 25
4-Piperidinone, 1-cyclobutyl- REF: IN-DA00I74VCAS: 359880-05-0	98%	205.00 €~477.00 €	Thu 10 Apr 25
1-Cyclobutylpiperidin-4-one REF: 3D-FC138178CAS: 359880-05-0	Min. 95%	- - -	Discontinued product