CymitQuimica logo

CAS 35999-53-2

:

1,3-Butanedione, 4,4,4-trifluoro-1-(4-nitrophenyl)-

Description:
1,3-Butanedione, 4,4,4-trifluoro-1-(4-nitrophenyl)-, also known by its CAS number 35999-53-2, is an organic compound characterized by its unique structure that includes a butanedione backbone substituted with trifluoromethyl and nitrophenyl groups. This compound typically exhibits a yellow crystalline appearance and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and stability, while the nitrophenyl moiety can impart specific electronic properties, making it useful in various chemical reactions. Additionally, the compound may exhibit interesting biological activities, although specific toxicity and safety data should be consulted for handling and usage. Its reactivity can be influenced by the electron-withdrawing effects of the trifluoromethyl and nitro groups, which can affect its behavior in chemical reactions. Overall, this compound represents a valuable entity in the field of synthetic organic chemistry.
Formula:C10H6F3NO4
InChI:InChI=1S/C10H6F3NO4/c11-10(12,13)9(16)5-8(15)6-1-3-7(4-2-6)14(17)18/h1-4H,5H2
InChI key:CDSAMNVLRSHLPN-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)CC(=O)C(F)(F)F)[N+](=O)[O-]
Found 4 products.