CAS 36001-47-5
:Vescalagin
Description:
Vescalagin is a naturally occurring ellagitannin, a type of polyphenolic compound primarily found in various plants, particularly in the bark and leaves of certain oak species. It is known for its antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and antimicrobial effects. Vescalagin has a complex structure characterized by multiple hydroxyl groups, which enhance its reactivity and ability to scavenge free radicals. This compound is also of interest in the field of pharmacology due to its potential role in preventing chronic diseases, such as cancer and cardiovascular disorders. In addition to its biological activities, vescalagin can influence the flavor and color of food products, making it relevant in the food industry. Its solubility in water and organic solvents varies, which can affect its extraction and application in various formulations. Overall, vescalagin represents a significant area of study in both natural product chemistry and health sciences, highlighting the importance of plant-derived compounds in therapeutic applications.
Formula:C41H26O26
InChI:InChI=1/C41H26O26/c42-8-1-5-12(24(48)21(8)45)13-6(2-9(43)22(46)25(13)49)39(60)65-34-11(4-63-37(5)58)64-38(59)7-3-10(44)23(47)26(50)14(7)15-18-16(28(52)32(56)27(15)51)17-19-20(30(54)33(57)29(17)53)31(55)35(66-41(19)62)36(34)67-40(18)61/h1-3,11,31,34-36,42-57H,4H2/t11?,31-,34-,35-,36?/m1/s1
InChI key:InChIKey=UDYKDZHZAKSYCO-UHFFFAOYSA-N
SMILES:OC1=C2C3=C(C=4C(C(=O)OC5C(C(OC3=O)C6C(O)C7=C(C2=C(O)C(O)=C7O)C(=O)O6)OC(=O)C=8C(C=9C(C(=O)OC5)=CC(O)=C(O)C9O)=C(O)C(O)=C(O)C8)=CC(O)=C(O)C4O)C(O)=C1O
Synonyms:- (2R,42R,46R)-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37,46-hexadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34,36,38-pentadecaene-4,17,22,40,44-pentone (non-preferred name)
- 1-epi-Castalagin
- 32H-29,5,9-(Epoxyethanylylidyne)-1,30-methano-14H,16H-dibenzo[h,o]dibenzo[7,8:9,10][1,5]dioxacycloundecino[3,2-b][1,6]dioxacycloheptadecin-14,18,27,32,35-pentone, 15a,28a,29,30-tetrahydro-2,3,4,6,7,8,10,11,12,20,21,22,23,24,25,33-hexadecahydroxy-, stereoisomer
- NSC 297812
- Stereoisomer of 15a,28a,29,30-tetrahydro-2,3,4,6,7,8,10,11,12,20,21,22,23,24,25,33-hexadecahydroxy-32H-29,5,9-(epoxyethanylylidyne)-1,30-methano-14H,16H-dibenzo[h,o]dibenzo[7,8:9,10][1,5]dioxacycloundecino[3,2-b][1,6]dioxacycloheptadecin-14,18,27,32,35-pentone
- Vescalagin
- Nsc297812
- Vescalagin-RM
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Vescalagin
CAS:Natural glycosideFormula:C41H26O26Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:934.64Vescalagin
CAS:Controlled ProductVescalagin is a naturally occurring polyphenol compound, which is derived from ellagitannins, primarily found in oak wood and various plants. Its source, the ellagitannin vescalagin, originates from the hydrolysis of tannins, a class of complex phenolic compounds abundant in nature. The mode of action of vescalagin involves binding to metal ions and proteins, which contributes to its potent antioxidant properties by scavenging free radicals and protecting cells from oxidative stress.Formula:C41H26O26Purity:Min. 95%Molecular weight:934.6 g/mol



