CAS 36015-19-7
:2-Chloro-5-nitrocinnamic acid
Description:
2-Chloro-5-nitrocinnamic acid is an organic compound characterized by its aromatic structure, which includes a cinnamic acid backbone substituted with both a chlorine atom and a nitro group. The presence of these functional groups contributes to its unique chemical properties. The chlorine atom, being electronegative, can influence the compound's reactivity and polarity, while the nitro group is known for its strong electron-withdrawing effects, which can enhance the acidity of the carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its derivatives can be explored for applications in materials science and organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity. Overall, 2-Chloro-5-nitrocinnamic acid is a valuable compound in various chemical research fields.
Formula:C9H5ClNO4
InChI:InChI=1/C9H6ClNO4/c10-8-3-2-7(11(14)15)5-6(8)1-4-9(12)13/h1-5H,(H,12,13)/p-1/b4-1+
Synonyms:- (2E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid
- (2E)-3-(2-chloro-5-nitrophenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-5-nitrocinnamic Acid
CAS:Formula:C9H6ClNO4Purity:>97.0%(GC)(T)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:227.603-(2-Chloro-5-nitrophenyl)acrylic acid
CAS:Formula:C9H6ClNO4Purity:95%Color and Shape:SolidMolecular weight:227.60122-Chloro-5-nitrocinnamic acid
CAS:2-Chloro-5-nitrocinnamic acidPurity:98%Molecular weight:227.60124g/mol2-Chloro-5-nitrocinnamic acid
CAS:<p>2-Chloro-5-nitrocinnamic acid is a plant growth regulator that inhibits the root development of plants by interfering with the synthesis of 3-chlorocinnamic acid, which is a precursor in the biosynthesis of lignin. 2-Chloro-5-nitrocinnamic acid inhibits the enzyme cinnamoyl CoA reductase, which catalyzes the first step in this biosynthetic pathway. This compound also has shown to be a strong inhibitor of ester derivatives and pesticides, such as carbaryl and dichlorvos.</p>Formula:C9H6ClNO4Purity:Min. 95%Color and Shape:PowderMolecular weight:227.6 g/mol




