CAS 3604-87-3
:α-Ecdysone
Description:
α-Ecdysone, with the CAS number 3604-87-3, is a naturally occurring steroid hormone belonging to the ecdysteroid class, primarily found in insects and some plants. It plays a crucial role in regulating molting and metamorphosis in arthropods. Chemically, α-ecdysone is characterized by its steroid structure, which includes a cyclopentanoperhydrophenanthrene core, and it features multiple hydroxyl groups that contribute to its biological activity. This compound is typically a white to off-white crystalline solid and is soluble in organic solvents like ethanol and methanol but has limited solubility in water. α-Ecdysone is of significant interest in various fields, including agriculture, where it is explored for its potential as a natural insect growth regulator, and in health and fitness, where it is studied for its anabolic properties. Its biological effects are mediated through specific receptors, influencing gene expression and cellular processes. Overall, α-ecdysone is a vital compound in both ecological and pharmacological contexts.
Formula:C27H44O6
InChI:InChI=1S/C27H44O6/c1-15(20(28)8-9-24(2,3)32)16-7-11-27(33)18-12-21(29)19-13-22(30)23(31)14-25(19,4)17(18)6-10-26(16,27)5/h12,15-17,19-20,22-23,28,30-33H,6-11,13-14H2,1-5H3/t15-,16+,17-,19-,20+,22+,23-,25+,26+,27+/m0/s1
InChI key:InChIKey=UPEZCKBFRMILAV-JMZLNJERSA-N
SMILES:O[C@]12C=3[C@@]([C@]4(C)[C@](C(=O)C3)(C[C@@H](O)[C@@H](O)C4)[H])(CC[C@]1(C)[C@@]([C@@H]([C@@H](CCC(C)(C)O)O)C)(CC2)[H])[H]
Synonyms:- (2β,3β,5β,22R)-2,3,14,22,25-Pentahydroxycholest-7-en-6-on
- (2β,3β,5β,22R)-2,3,14,22,25-pentahidroxicolest-7-en-6-ona
- (2β,3β,5β,22R)-2,3,14,22,25-pentahydroxycholest-7-en-6-one
- (2β,3β,5β,22R)-2,3,14,22,25-pentahydroxycholest-7-ene-6-one
- 5β-Cholest-7-en-6-one, 2β,3β,14,22,25-pentahydroxy-, (20S,22R)-
- Ecdysone
- α-Ecdysone
- BRN 2422986
- (2beta,3beta,5beta,9xi,22R)-2,3,14,22,25-pentahydroxycholest-7-en-6-one
- Hydroxyecdysone
- (2beta,3beta,5beta,22R)-2,3,14,22,25-Pentahydroxycholest-7-en-6-one
- Cholest-7-en-6-one, 2,3,14,22,25-pentahydroxy-, (2-beta,3-beta,5-beta,22R)- (9CI)
- AI3-44726
- 20-Hydroxyecdysone
- CCRIS 6931
- alpha-Ecdysone
- 4-08-00-03613 (Beilstein Handbook Reference)
- Cholest-7-en-6-one, 2,3,14,22,25-pentahydroxy-, (2β,3β,5β,22R)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
α-Ecdysone
CAS:alpha-Ecdysone analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C27H44O6Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:464.65Ecdysone
CAS:Ecdysone is a major steroid hormone in insects and herbs.Formula:C27H44O6Purity:99.22%Color and Shape:PowderMolecular weight:464.63α-Ecdysone
CAS:Formula:C27H44O6Purity:≥ 95.0%Color and Shape:White to off-white powderMolecular weight:464.63a-Ecdysone
CAS:Controlled Producta-Ecdysone is a steroidal hormone, which is naturally found in various arthropods and some plant species. It is synthesized from cholesterol and is a key regulator in the molting and metamorphosis processes in insects. The mode of action involves binding to the ecdysone receptor, a type of nuclear receptor, which then forms a complex with another protein complex to regulate the expression of specific target genes. This binding and gene regulation are crucial for initiating and controlling series of developmental processes.Formula:C27H44O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:464.63 g/molα-Ecdysone ( >90%)
CAS:Controlled ProductApplications α-Ecdysone is a steroidal prohormone.
References Morgan, E., et al.: Comp. Biochem. Biophys., 578, 99 (1977)Formula:C27H44O6Purity:>90%Color and Shape:NeatMolecular weight:464.63
