CAS 36051-69-1

Uridine 5′-(tetrahydrogen triphosphate), sodium salt (1:2)

Description:

Uridine 5′-(tetrahydrogen triphosphate), sodium salt (1:2), commonly referred to as UTP, is a nucleotide that plays a crucial role in cellular metabolism and signaling. It is a derivative of uridine, which is a nucleoside composed of the nitrogenous base uracil and the sugar ribose. UTP is characterized by its triphosphate group, which consists of three phosphate groups linked by high-energy bonds, making it an important energy currency in biochemical reactions. In its sodium salt form, UTP is soluble in water, facilitating its participation in various enzymatic processes. It serves as a substrate for RNA synthesis during transcription and is involved in the synthesis of glycogen and other polysaccharides. Additionally, UTP acts as a signaling molecule in various cellular pathways, influencing processes such as cell proliferation and differentiation. Its stability and reactivity are influenced by the presence of the phosphate groups, which can undergo hydrolysis to release energy for cellular activities. Overall, UTP is essential for numerous biological functions, highlighting its significance in biochemistry and molecular biology.

Formula: C₉H₁₅N₂O₁₅P₃·2Na

InChI: InChI=1S/C9H15N2O15P3.2Na/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(24-8)3-23-28(19,20)26-29(21,22)25-27(16,17)18;;/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H,21,22)(H,10,12,15)(H2,16,17,18);;/t4-,6-,7-,8-;;/m1../s1

InChI key: InChIKey=NNIPRTSFXCEXTA-WFIJOQBCSA-N

SMILES: O[C@H]1[C@@H](O[C@H](COP(OP(OP(=O)(O)O)(=O)O)(=O)O)[C@H]1O)N2C(=O)NC(=O)C=C2.[Na]

Synonyms:

• Uridine-5′-triphosphate disodium salt
• Disodium uridine triphosphate
• Uridine 5′-(tetrahydrogen triphosphate), disodium salt
• Uridine 5′-(tetrahydrogen triphosphate), sodium salt (1:2)

Uridine 5′-(tetrahydrogen triphosphate), sodium salt (1:2)

CAS: 36051-69-1

Formula: C₉H₁₅N₂NaO₁₅P₃

Molecular weight: 507.1309

Ref: IN-DA01X3YW

Uridine 5'-triphosphate disodium

CAS: 36051-69-1

Uridine 5'-triphosphate disodium salt is a supramolecular complex that binds to gold nanoparticles. The binding of uridine 5'-triphosphate disodium salt to gold nanoparticles can be used for the detection of metal ions through the photometric method. Uridine 5'-triphosphate disodium salt has been shown to inhibit the glutathione-dependent reduction of vitamin B12, which is a key step in methionine synthesis and folate metabolism. This inhibition may lead to a decrease in protein synthesis, ATP production, and cell division.

Formula: C₉H₁₅N₂O₁₅P₃•Na₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 530.12 g/mol

Ref: 3D-NU10275