CAS 360561-53-1: 4-[[5-[[4-(3-Chlorophenyl)-3-oxo-1-piperazinyl]methyl]-1H-imidazol-1-yl]methyl]-2-phenoxybenzonitrile

Description:The chemical substance known as 4-[[5-[[4-(3-Chlorophenyl)-3-oxo-1-piperazinyl]methyl]-1H-imidazol-1-yl]methyl]-2-phenoxybenzonitrile, with the CAS number 360561-53-1, is a complex organic compound characterized by its multi-functional structure. It features a piperazine ring, which is often associated with pharmacological activity, and an imidazole moiety that can participate in various chemical interactions. The presence of a chlorophenyl group suggests potential lipophilicity, which may influence its bioavailability and interaction with biological targets. Additionally, the phenoxy and benzonitrile groups contribute to its overall stability and reactivity. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the complexity and diversity of modern synthetic organic chemistry.

Formula:C₂₈H₂₄ClN₅O₂

InChI:InChI=1S/C28H24ClN5O2/c29-23-5-4-6-24(14-23)34-12-11-32(19-28(34)35)18-25-16-31-20-33(25)17-21-9-10-22(15-30)27(13-21)36-26-7-2-1-3-8-26/h1-10,13-14,16,20H,11-12,17-19H2

InChI key:InChIKey=JAUARQFUHQYXHN-UHFFFAOYSA-N

SMILES:N#CC1=CC=C(C=C1OC=2C=CC=CC2)CN3C=NC=C3CN4CC(=O)N(C=5C=CC=C(Cl)C5)CC4

Synonyms:
Benzonitrile, 4-[[5-[[4-(3-chlorophenyl)-3-oxo-1-piperazinyl]methyl]-1H-imidazol-1-yl]methyl]-2-phenoxy-
4-[[5-[[4-(3-Chlorophenyl)-3-oxo-1-piperazinyl]methyl]-1H-imidazol-1-yl]methyl]-2-phenoxybenzonitrile