CAS 360576-05-2

methyl 4-bromo-7-fluoro-1-benzothiophene-2-carboxylate

Description:

Methyl 4-bromo-7-fluoro-1-benzothiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiophene core substituted with bromine and fluorine atoms, as well as a carboxylate ester functional group. This compound typically exhibits a range of physical and chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of halogen substituents. The bromine and fluorine atoms can influence the compound's electronic properties, making it of interest in various chemical applications, including medicinal chemistry and materials science. The presence of the carboxylate group suggests potential for further functionalization or reactivity in synthetic pathways. Additionally, the compound's structure may impart specific biological activities, making it a candidate for research in pharmacology. As with many halogenated compounds, considerations regarding environmental impact and safety are important, particularly in terms of toxicity and persistence in biological systems.

Formula: C₁₀H₆BrFO₂S

InChI: InChI=1/C10H6BrFO2S/c1-14-10(13)8-4-5-6(11)2-3-7(12)9(5)15-8/h2-4H,1H3

Synonyms:

• Methyl-4-brom-7-fluor-1-benzothiophen-2-carboxylat

Methyl 4-bromo-7-fluorobenzo[b]thiophene-2-carboxylate

CAS: 360576-05-2

Methyl 4-bromo-7-fluorobenzo[b]thiophene-2-carboxylate

Formula: C₁₀H₆BrFO₂S

Purity: 95%

Color and Shape: white solid

Molecular weight: 289.12g/mol

Ref: 54-PC57446