CAS 360576-06-3

4-bromo-7-fluoro-1-benzothiophene-2-carboxylic acid

Description:

4-Bromo-7-fluoro-1-benzothiophene-2-carboxylic acid is a heterocyclic organic compound characterized by its unique structure, which includes a benzothiophene core substituted with bromine and fluorine atoms, as well as a carboxylic acid functional group. The presence of the bromine and fluorine substituents contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding. Additionally, the thiophene ring may impart aromatic stability and influence the compound's electronic properties. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. The CAS number 360576-06-3 uniquely identifies this substance in chemical databases, facilitating its study and application in various fields.

Formula: C₉H₄BrFO₂S

InChI: InChI=1/C9H4BrFO2S/c10-5-1-2-6(11)8-4(5)3-7(14-8)9(12)13/h1-3H,(H,12,13)

SMILES: c1cc(c2c(cc(C(=O)O)s2)c1Br)F

4-Bromo-7-fluorobenzo[b]thiophene-2-carboxylic acid

CAS: 360576-06-3

4-Bromo-7-fluorobenzo[b]thiophene-2-carboxylic acid

Formula: C₉H₄BrFO₂S

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 275.09g/mol

Ref: 54-PC502239