CAS 36070-79-8
:6-chloropyrazine-2-carboxamide
Description:
6-Chloropyrazine-2-carboxamide is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The presence of a chlorine atom at the 6-position and a carboxamide group at the 2-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the carboxamide functional group. It may exhibit biological activity, making it of interest in pharmaceutical research. The compound's structure allows for potential interactions with various biological targets, which can be explored for medicinal applications. Additionally, its reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent, affecting its behavior in chemical reactions. Overall, 6-chloropyrazine-2-carboxamide serves as a valuable compound in both synthetic chemistry and drug development contexts.
Formula:C5H4ClN3O
InChI:InChI=1/C5H4ClN3O/c6-4-2-8-1-3(9-4)5(7)10/h1-2H,(H2,7,10)
SMILES:c1c(C(=N)O)nc(cn1)Cl
Synonyms:- 2-Pyrazinecarboxamide, 6-Chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-chloro-2-pyrazinecarboxamide
CAS:Formula:C5H4ClN3OPurity:97%Color and Shape:SolidMolecular weight:157.55786-Chloropyrazine-2-carboxamide
CAS:6-Chloropyrazine-2-carboxamidePurity:97%Molecular weight:157.56g/mol6-Chloropyrazine-2-carboxamide
CAS:Formula:C5H4ClN3OPurity:97%Color and Shape:Solid, White powderMolecular weight:157.566-Chloropyrazine-2-carboxamide
CAS:<p>6-Chloropyrazine-2-carboxamide is a tuberculostatic agent that inhibits the growth of Mycobacterium tuberculosis by alkylating nucleophilic sites on the bacterial cell wall. The antimycobacterial activity of 6-chloropyrazine-2-carboxamide has been shown in vitro using a densitometric assay, where it was able to inhibit the growth of M. tuberculosis. This drug also possesses antibacterial properties and has been shown to be effective against other bacteria such as Escherichia coli and Staphylococcus aureus. 6-Chloropyrazine-2-carboxamide is an amidating agent that reacts with amines to form amides or with carboxylic acids to form esters, which may have been used for its synthesis.<br>6-Chloropyrazine-2-carboxamide is a white crystalline powder that is soluble in water and alcohol</p>Formula:C5H4ClN3OPurity:Min. 95%Molecular weight:157.56 g/mol



