CAS 36075-44-2
:4-hydrazinylquinazoline
Description:
4-Hydrazinylquinazoline is an organic compound characterized by the presence of a hydrazine functional group (-NH-NH2) attached to a quinazoline ring system. Quinazoline itself is a bicyclic structure composed of a benzene ring fused to a pyrimidine ring, which contributes to the compound's aromaticity and stability. The hydrazinyl group introduces potential for reactivity, particularly in forming hydrazones or participating in condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its properties include moderate solubility in polar solvents, and it may display various physical characteristics such as melting point and boiling point that are typical of similar heterocyclic compounds. Additionally, 4-hydrazinylquinazoline may participate in various chemical reactions, including oxidation and substitution, due to the presence of both the hydrazine and quinazoline moieties. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential reactivity of the hydrazine group.
Formula:C8H8N4
InChI:InChI=1/C8H8N4/c9-12-8-6-3-1-2-4-7(6)10-5-11-8/h1-5H,9H2,(H,10,11,12)
SMILES:c1ccc2c(c1)c(ncn2)NN
Synonyms:- 4-Hydrazinoquinazoline
- Quinazoline, 4-Hydrazinyl-
- 4-hydrazinoquinazoline(SALTDATA: FREE)
- 4-
- 4-Hydrazinylquinazoline
- Hydrazinoquinazoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Hydrazinoquinazoline
CAS:4-HydrazinoquinazolineFormula:C8H8N4Purity:≥95%Color and Shape:SolidMolecular weight:160.18g/mol4-Hydrazinoquinazoline
CAS:4-Hydrazinoquinazoline is a type of inhibitor that binds to the polymerase domain of the ns5B enzyme and inhibits bacterial growth. The binding of 4-hydrazinoquinazoline to the polymerase domain of the ns5B enzyme prevents the formation of nucleotides, which are necessary for RNA synthesis. 4-Hydrazinoquinazoline has been shown to be an effective antibacterial agent with a broad spectrum against Gram-positive and Gram-negative bacteria, as well as fungi. It has also been shown to be active against Mycobacterium tuberculosis in culture. 4-Hydrazinoquinazoline is used in small amounts because it is unstable in aqueous solution.Formula:C8H8N4Purity:Min. 95%Molecular weight:160.18 g/mol



