CAS 360778-55-8

Benzoic acid, 3-[(2,4-dichlorophenyl)methoxy]-

Description:

Benzoic acid, 3-[(2,4-dichlorophenyl)methoxy]- is an organic compound characterized by its benzoic acid core, which features a methoxy group attached to the third carbon of the benzene ring and a dichlorophenyl group at the para position. This compound is typically a white to off-white solid at room temperature and is known for its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic characteristics. The presence of the dichlorophenyl moiety contributes to its potential biological activity and may influence its reactivity and interaction with other chemical species. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry and material science. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.

Formula: C₁₄H₁₀Cl₂O₃

InChI: InChI=1S/C14H10Cl2O3/c15-11-5-4-10(13(16)7-11)8-19-12-3-1-2-9(6-12)14(17)18/h1-7H,8H2,(H,17,18)

InChI key: InChIKey=HYYJRKVTWQOQRO-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=C(Cl)C=C1)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 3-[(2,4-Dichlorobenzyl)oxy]benzoic acid
• Benzoic acid, 3-[(2,4-dichlorophenyl)methoxy]-
• 3-[(2,4-Dichlorophenyl)methoxy]benzoic acid

Nurr1 agonist 8

CAS: 360778-55-8

Nurr1 agonist 8

Purity: ≥98%

Molecular weight: 297.13g/mol

Ref: 54-BUP10275

Nurr1 agonist 8

CAS: 360778-55-8

Nurr1 agonist 8 is a low-affinity Nurr1 agonist that can be used to study neurological diseases such as Parkinson's.

Formula: C₁₄H₁₀Cl₂O₃

Purity: 99.79%

Color and Shape: Solid

Molecular weight: 297.13

Ref: TM-T81632