
CAS 36107-02-5: 5,7-Dibromo-8-quinolinamine
Description:5,7-Dibromo-8-quinolinamine is an organic compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound contains two bromine substituents at the 5 and 7 positions and an amino group at the 8 position of the quinoline ring. The presence of bromine atoms enhances its reactivity and can influence its solubility and stability in various solvents. The amino group contributes to its potential as a ligand in coordination chemistry and may also impart basic properties to the molecule. 5,7-Dibromo-8-quinolinamine is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as antimicrobial or anticancer properties. Its synthesis typically involves bromination reactions followed by amination processes. As with many brominated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with brominated organic compounds.
Formula:C9H6Br2N2
InChI:InChI=1S/C9H6Br2N2/c10-6-4-7(11)8(12)9-5(6)2-1-3-13-9/h1-4H,12H2
InChI key:InChIKey=SMXOUFFPKVBWEE-UHFFFAOYSA-N
SMILES:BrC1=CC(Br)=C2C=CC=NC2=C1N
- Synonyms:
- 8-Quinolinamine, 5,7-dibromo-
- 5,7-Dibromo-8-aminoquinoline
- 5,7-Dibromo-8-quinolinamine
- 8-Amino-5,7-dibromoquinoline
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5,7-Dibromoquinolin-8-amine REF: IN-DA00CTZQCAS: 36107-02-5 | 95% | To inquire | Wed 16 Apr 25 |
![]() | 5,7-Dibromoquinolin-8-amine REF: 54-OR93532CAS: 36107-02-5 | 95% | 244.00 € | Thu 17 Apr 25 |
![]() | 5,7-Dibromoquinolin-8-amine REF: 10-F756942CAS: 36107-02-5 | 95+% | 45.00 €~969.00 € | Mon 21 Apr 25 |
![]() | 5,7-Dibromoquinolin-8-amine REF: 3D-LBA10702CAS: 36107-02-5 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA00CTZQ
1g | 165.00 € | ||
5g | 513.00 € | ||
10g | 588.00 € | ||
25g | To inquire | ||
100mg | 65.00 € | ||
250mg | 104.00 € |

Ref: 10-F756942
1g | 115.00 € | ||
5g | 318.00 € | ||
10g | 486.00 € | ||
25g | 969.00 € | ||
100mg | 45.00 € | ||
250mg | 71.00 € |

5,7-Dibromoquinolin-8-amine
Ref: 3D-LBA10702
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |