CAS 36122-35-7
:Phenylmaleic anhydride
Description:
Phenylmaleic anhydride, with the CAS number 36122-35-7, is an organic compound characterized by its anhydride functional group derived from maleic acid and a phenyl substituent. It typically appears as a white to light yellow crystalline solid and is known for its reactivity, particularly in polymer chemistry and as a building block in organic synthesis. The compound exhibits a high melting point and is soluble in organic solvents such as acetone and chloroform, but is generally insoluble in water. Its structure features a maleic anhydride core, which contributes to its ability to undergo various chemical reactions, including Diels-Alder reactions and nucleophilic additions. Phenylmaleic anhydride is utilized in the production of resins, coatings, and as an intermediate in the synthesis of other chemical compounds. Safety precautions should be observed when handling this substance, as it may cause irritation to the skin and eyes. Overall, its unique properties make it valuable in both industrial applications and research settings.
Formula:C10H6O3
InChI:InChI=1S/C10H6O3/c11-9-6-8(10(12)13-9)7-4-2-1-3-5-7/h1-6H
InChI key:InChIKey=QZYCWJVSPFQUQC-UHFFFAOYSA-N
SMILES:O=C1C(=CC(=O)O1)C2=CC=CC=C2
Synonyms:- 2,5-Furandione, 3-phenyl-
- 3-Phenyl-2,5-dihydrofuran-2,5-dione
- 3-Phenyl-2,5-furandione
- 3-Phenylfuran-2,5-Dione
- Maleic anhydride, phenyl-
- NSC 191772
- Phenylmaleic anhydride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenylmaleic Anhydride
CAS:Formula:C10H6O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:174.16Phenylmaleic anhydride
CAS:Phenylmaleic anhydrideFormula:C10H6O3Purity:≥95%Color and Shape: faint yellow/beige crystalline solidMolecular weight:174.15g/mol3-Phenyl-2,5-dihydrofuran-2,5-dione
CAS:Formula:C10H6O3Purity:97%Color and Shape:SolidMolecular weight:174.155Phenylmaleic Anhydride
CAS:Phenylmaleic anhydride is a polycarboxylic acid that contains a reactive carbonyl group. It can be used as an intermediate in the synthesis of prostacyclin receptor agonists and has been shown to have anti-inflammatory effects in various animal models. Phenylmaleic anhydride is also used as an ingredient in creams or gels that are applied to the skin for treatments of inflammatory diseases such as psoriasis, eczema, or dermatitis. Some of the properties of phenylmaleic anhydride include viscosity and hydrogen bonding ability, which make it useful for these types of applications.Formula:C10H6O3Purity:Min. 95%Molecular weight:174.16 g/mol




