CAS 3613-83-0
:2,2-dichloro-N-(2-hydroxyethyl)-N-(4-hydroxyphenyl)acetamide
Description:
2,2-Dichloro-N-(2-hydroxyethyl)-N-(4-hydroxyphenyl)acetamide, with CAS number 3613-83-0, is a chemical compound that belongs to the class of acetamides. It features a dichloro substituent, which contributes to its reactivity and potential biological activity. The presence of hydroxyethyl and hydroxyphenyl groups indicates that the compound may exhibit both hydrophilic and hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound is often studied for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive molecules. Its structure suggests that it may have antioxidant properties due to the presence of the phenolic hydroxyl group. Additionally, the dichloro substituents may impart specific chemical properties that could be relevant in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as compounds with halogenated groups can exhibit varying degrees of toxicity and environmental impact. Overall, this compound's unique structure positions it as a subject of interest in chemical research and development.
Formula:C10H11Cl2NO3
InChI:InChI=1/C10H11Cl2NO3/c11-9(12)10(16)13(5-6-14)7-1-3-8(15)4-2-7/h1-4,9,14-15H,5-6H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetanilide, 2,2-dichloro-4'-hydroxy-N-(2-hydroxyethyl)-
CAS:<p>Acetanilide, 2,2-dichloro-4'-hydroxy-N-(2-hydroxyethyl)- is a bioactive chemical.</p>Formula:C10H11Cl2NO3Color and Shape:SolidMolecular weight:264.11
