CAS 361342-51-0: (11bR)-2,6-Di-9-anthracenyl-4-hydroxydinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin 4-oxide
Description:(11bR)-2,6-Di-9-anthracenyl-4-hydroxydinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin 4-oxide is a complex organophosphorus compound characterized by its unique structural features, including a dioxaphosphepin core and multiple anthracene moieties. This compound exhibits significant photophysical properties, making it of interest in materials science and organic electronics. The presence of hydroxyl groups contributes to its potential reactivity and solubility in various solvents. Its intricate structure may also impart interesting electronic properties, which can be leveraged in applications such as light-emitting devices or as a building block in organic synthesis. The compound's stability and reactivity are influenced by the phosphorus atom in the dioxaphosphepin ring, which can participate in various chemical reactions. Overall, this substance represents a fascinating intersection of organic chemistry and materials science, with potential applications in advanced technologies.
Formula:C48H29O4P
InChI:InChI=1S/C48H29O4P/c49-53(50)51-47-41(43-35-19-7-1-13-29(35)25-30-14-2-8-20-36(30)43)27-33-17-5-11-23-39(33)45(47)46-40-24-12-6-18-34(40)28-42(48(46)52-53)44-37-21-9-3-15-31(37)26-32-16-4-10-22-38(32)44/h1-28H,(H,49,50)
InChI key:InChIKey=QYJHYRSRVCOHMY-UHFFFAOYSA-N
SMILES:O=P1(O)OC=2C(=CC=3C=CC=CC3C2C=4C(O1)=C(C=C5C=CC=CC54)C6=C7C=CC=CC7=CC=8C=CC=CC86)C9=C%10C=CC=CC%10=CC=%11C=CC=CC%119
- Synonyms:
- (11Br)-2,6-Di-9-Anthracenyl-4-Hydroxy-Dinaphtho[2,1-D:1Μ,2Μ-F][1,3,2]Dioxaphosphepin-4-Oxide
- (11bR)-2,6-Di-9-anthracenyl-4-hydroxydinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin 4-oxide
- Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin, 2,6-di-9-anthracenyl-4-hydroxy-, 4-oxide, (11bR)-

(11bR)-2,6-Di-9-anthracenyl-4-hydroxy-dinaphtho[2,1-d
Ref: IN-DA00CKVU
1g | 248.00 € | ||
25mg | 59.00 € | ||
50mg | 64.00 € | ||
100mg | 91.00 € | ||
250mg | 182.00 € |

(R)-3,3'-Bis(anthracenyl-9-yl)-1,1'-binapthyl-2,2'-diyl hydrogenphosphate
Ref: 54-OR340032
1g | 489.00 € | ||
5g | 2,156.00 € | ||
100mg | 84.00 € | ||
250mg | 188.00 € |

(11bR)-2,6-Di-9-anthracenyl-4-hydroxy-4-oxide-dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin, min. 98%
Ref: 08-15-0251
25mg | 117.00 € | ||
100mg | 225.00 € |

(R)-3,3'-Bis(anthracenyl-9-yl)-1,1'-binapthyl-2,2'-diyl hydrogenphosphate
Ref: 3D-LPA34251
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |