CAS 361344-43-6

[4-(morpholin-4-yl)phenyl](oxo)acetaldehyde

Description:

[4-(Morpholin-4-yl)phenyl](oxo)acetaldehyde, with the CAS number 361344-43-6, is an organic compound characterized by its unique functional groups and structural features. It contains a phenyl ring substituted with a morpholine group, which contributes to its potential biological activity and solubility properties. The presence of the aldehyde functional group (oxo) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound may exhibit polar characteristics due to the morpholine and aldehyde groups, influencing its interactions in biological systems and its solubility in different solvents. Additionally, the morpholine moiety can enhance the compound's ability to form hydrogen bonds, potentially affecting its pharmacokinetic properties. Overall, [4-(morpholin-4-yl)phenyl](oxo)acetaldehyde is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents. Its specific reactivity and biological activity would depend on further studies and characterization.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1/C12H13NO3/c14-9-12(15)10-1-3-11(4-2-10)13-5-7-16-8-6-13/h1-4,9H,5-8H2

SMILES: c1cc(ccc1C(=O)C=O)N1CCOCC1

4-Morpholinophenylglyoxal

CAS: 361344-43-6

4-Morpholinophenylglyoxal

Purity: ≥95%

Molecular weight: 219.24g/mol

Ref: 54-OR322274