CymitQuimica logo

CAS 361346-80-7

:

cobalt(2+) (2E,2'E)-3,3'-{[(1R,2R)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diyl]bis[nitrilo(E)methylylidene]}bis(4-oxopent-2-en-2-olate)

Description:
Cobalt(2+) (2E,2'E)-3,3'-{[(1R,2R)-1,2-bis(2,4,6-trimethylphenyl)ethane-1,2-diyl]bis[nitrilo(E)methylylidene]}bis(4-oxopent-2-en-2-olate) is a complex cobalt compound characterized by its coordination with a tetradentate ligand that features a bis(nitrilo) structure. The cobalt ion in the +2 oxidation state typically exhibits a coordination number of six, often forming octahedral complexes. This compound is notable for its intricate organic ligand, which includes bulky trimethylphenyl groups that can influence its solubility and steric properties. The presence of the 4-oxopent-2-en-2-olate moieties suggests potential reactivity and coordination behavior, making it of interest in various chemical applications, including catalysis and materials science. The specific stereochemistry indicated by the (1R,2R) configuration and the E/Z notation highlights the compound's potential for isomerism, which can affect its chemical behavior and interactions. Overall, this cobalt complex exemplifies the intersection of transition metal chemistry and organic ligand design, contributing to its unique properties and potential applications.
Formula:C32H38CoN2O4
InChI:InChI=1/C32H40N2O4.Co/c1-17-11-19(3)29(20(4)12-17)31(33-15-27(23(7)35)24(8)36)32(34-16-28(25(9)37)26(10)38)30-21(5)13-18(2)14-22(30)6;/h11-16,31-32,35,37H,1-10H3;/q;+2/p-2/b27-23+,28-25+,33-15+,34-16+;/t31-,32-;/m1./s1
InChI key:YQMKZEIIMHVFTI-SGIDGJHMSA-N
SMILES:Cc1cc(C)c(c(C)c1)C(C(c1c(C)cc(C)cc1C)N=CC(=C(C)O)C(=O)C)N=CC(=C(C)O)C(=O)C.[Co]
Synonyms:
  • [(3E,3'E)-3,3'-{[(1R,2R)-1,2-Dimesitylethane-1,2-diyl]bis[nitrilo(E)methylylidene]}bis[4-(hydroxy-kappaO)pent-3-en-2-onato](2-)]cobalt
  • cobalt, [(3E,3'E)-3,3'-[[(1R,2R)-1,2-bis(2,4,6-trimethylphenyl)-1,2-ethanediyl]bis[nitrilo(E)methylidyne]]bis[4-(hydroxy-kappaO)-3-penten-2-onato](2-)]-
Found 4 products.