CAS 36138-76-8
:5-Bromo-2-methylphenol
Description:
5-Bromo-2-methylphenol, with the CAS number 36138-76-8, is an organic compound that belongs to the class of brominated phenols. It features a bromine atom and a methyl group attached to a phenolic ring, specifically at the 5 and 2 positions, respectively. This compound is typically characterized by its solid state at room temperature and exhibits a white to light yellow crystalline appearance. It is known for its antimicrobial properties, making it useful in various applications, including as a preservative in cosmetics and pharmaceuticals. The presence of the bromine atom enhances its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, 5-Bromo-2-methylphenol is soluble in organic solvents but has limited solubility in water. Safety considerations should be taken into account when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate protective measures should be employed.
Formula:C7H7BrO
InChI:InChI=1/C7H7BrO/c1-5-2-3-6(8)4-7(5)9/h2-4,9H,1H3
SMILES:Cc1ccc(cc1O)Br
Synonyms:- Phenol,5-bromo-2-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-methylphenol, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7BrOPurity:95%Color and Shape:Pale cream to cream to brown, Crystals or powder or crystalline powderMolecular weight:187.04Ref: IN-DA00C0RE
1kgTo inquire5g25.00€1g28.00€10g34.00€25g57.00€50g81.00€100g120.00€250g191.00€500g359.00€5-Bromo-2-methylphenol
CAS:5-Bromo-2-methylphenolFormula:C7H7BrOPurity:≥95%Color and Shape: light brown-brown crystalline solidMolecular weight:187.03g/mol5-Bromo-2-methylphenol
CAS:5-Bromo-2-methylphenol (5BM) is a synthetic carbinol that is used in the synthesis of carbazole alkaloids. It has been shown to undergo regioselective brominations and rearrangements. 5BM can be synthesized from 2,3,4,5-tetrahydroxybenzaldehyde by reacting it with methyl bromide in the presence of a palladium catalyst. 5BM is also used as an electrophile in organic chemistry reactions. It can be used to synthesize various compounds such as pyridines, indoles, and benzofurans.
Formula:C7H7BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:187.03 g/mol




