CAS 3614-38-8

4-(Acetylamino)-N-[2-(diethylamino)ethyl]-2-methoxybenzamide

Description:

4-(Acetylamino)-N-[2-(diethylamino)ethyl]-2-methoxybenzamide, with CAS number 3614-38-8, is a chemical compound characterized by its complex structure, which includes an acetylamino group, a diethylamino moiety, and a methoxybenzamide framework. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its amine and aromatic components. The presence of the methoxy group can influence its electronic properties and reactivity, while the diethylamino group may enhance its lipophilicity, potentially affecting its pharmacokinetics if used in medicinal chemistry. The compound's structure suggests it may interact with biological targets, making it of interest in pharmaceutical research. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Overall, this compound's unique functional groups and structural features contribute to its potential applications in various chemical and biological contexts.

Formula: C₁₆H₂₅N₃O₃

InChI: InChI=1S/C16H25N3O3/c1-5-19(6-2)10-9-17-16(21)14-8-7-13(18-12(3)20)11-15(14)22-4/h7-8,11H,5-6,9-10H2,1-4H3,(H,17,21)(H,18,20)

InChI key: InChIKey=DOICERWTDRJLRV-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(NCCN(CC)CC)=O)C=CC(NC(C)=O)=C1

Synonyms:

• 4-(Acetylamino)-N-[2-(diethylamino)ethyl]-2-methoxybenzamide
• 1182JD
• m-Acetanisidide, 4′-[[2-(diethylamino)ethyl]carbamoyl]-
• Benzamide, 4-(acetylamino)-N-[2-(diethylamino)ethyl]-2-methoxy-

Bromopride Impurity 6

CAS: 3614-38-8

Formula: C₁₆H₂₅N₃O₃

Molecular weight: 307.39

Ref: 4Z-B-1913