CAS 36142-27-5
:Imidazo[1,2-b]isoquinoline-5,10-dione
Description:
Imidazo[1,2-b]isoquinoline-5,10-dione is a heterocyclic compound characterized by its fused imidazole and isoquinoline rings, which contribute to its unique chemical properties. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which can influence its reactivity and potential applications in medicinal chemistry. The structure of imidazo[1,2-b]isoquinoline-5,10-dione allows for various interactions, making it a candidate for biological activity, particularly in the development of pharmaceuticals. Its molecular framework may exhibit properties such as fluorescence, which can be useful in imaging applications. Additionally, the compound's ability to form hydrogen bonds and engage in π-π stacking interactions can enhance its stability and solubility in different solvents. Overall, imidazo[1,2-b]isoquinoline-5,10-dione is of interest in research for its potential therapeutic applications and as a building block in organic synthesis.
Formula:C11H6N2O2
InChI:InChI=1S/C11H6N2O2/c14-9-7-3-1-2-4-8(7)11(15)13-6-5-12-10(9)13/h1-6H
InChI key:InChIKey=YXEOGWKIIAIXJH-UHFFFAOYSA-N
SMILES:O=C1C=2N(C(=O)C=3C1=CC=CC3)C=CN2
Synonyms:- Imidazo[1,2-b]isoquinoline-5,10-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.