CymitQuimica logo

CAS 361431-27-8

:

9-cyclohexyl-N,N'-bis(4-methoxybenzyl)-9H-purine-2,6-diamine

Description:
9-Cyclohexyl-N,N'-bis(4-methoxybenzyl)-9H-purine-2,6-diamine is a synthetic organic compound that belongs to the purine class of molecules. It features a purine core, which is characterized by a fused double-ring structure containing nitrogen atoms. The compound is substituted at the 9-position with a cyclohexyl group, which contributes to its hydrophobic properties. Additionally, it has two 4-methoxybenzyl groups attached to the nitrogen atoms at the 2 and 6 positions, enhancing its solubility and potentially influencing its biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry, particularly in the context of targeting specific biological pathways or receptors. Its structural complexity and functional groups suggest potential interactions with various biological molecules, which could be explored in drug development. As with many synthetic compounds, its stability, solubility, and reactivity would depend on the specific conditions under which it is studied.
Formula:C27H32N6O2
InChI:InChI=1/C27H32N6O2/c1-34-22-12-8-19(9-13-22)16-28-25-24-26(33(18-30-24)21-6-4-3-5-7-21)32-27(31-25)29-17-20-10-14-23(35-2)15-11-20/h8-15,18,21H,3-7,16-17H2,1-2H3,(H2,28,29,31,32)
SMILES:COc1ccc(cc1)CNc1c2c(nc(=NCc3ccc(cc3)OC)[nH]1)n(cn2)C1CCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
  • Myoseverin B

    CAS:
    Formula:C27H32N6O2
    Molecular weight:472.58

    Ref: 7W-GL0355

    ne
    To inquire
  • Myoseverin B

    CAS:
    <p>Myoseverin B is a microtubule assembly inhibitor that impedes tubulin polymerization (IC50 = 2 μM) and generally exhibits low cytotoxicity across most cell types. It is utilized in antitumor agent research.</p>
    Formula:C27H32N6O2
    Color and Shape:Solid
    Molecular weight:472.582