CAS 361432-52-2
:5-Methoxyl-8-bromo-2-tetralone
Description:
5-Methoxyl-8-bromo-2-tetralone is an organic compound characterized by its unique structure, which includes a tetralone framework substituted with a methoxy group and a bromine atom. The presence of the methoxy group (-OCH3) typically enhances the compound's solubility in organic solvents and may influence its reactivity and biological activity. The bromine atom introduces a halogen, which can affect the compound's electronic properties and reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. This compound may exhibit interesting pharmacological properties, as many tetralone derivatives are known for their biological activities. Additionally, the specific arrangement of substituents can lead to distinct stereochemical configurations, which may further influence its interactions in biological systems. Overall, 5-Methoxyl-8-bromo-2-tetralone represents a valuable compound for research in organic chemistry and medicinal chemistry, with potential applications in drug development and synthesis.
Formula:C11H11BrO2
InChI:InChI=1/C11H11BrO2/c1-14-11-5-4-10(12)9-6-7(13)2-3-8(9)11/h4-5H,2-3,6H2,1H3
SMILES:COc1ccc(c2CC(=O)CCc12)Br
Synonyms:- 5-Methoxyl-8-bromo-3,4-dihydro-1H-naphthalen-2-one
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery