CAS 36145-03-6

2,2'-bipyridine-3,3'-diol

Description:

2,2'-Bipyridine-3,3'-diol, identified by its CAS number 36145-03-6, is an organic compound featuring a bipyridine structure with hydroxyl groups at the 3 and 3' positions. This compound exhibits characteristics typical of bipyridine derivatives, including the ability to participate in coordination chemistry due to the presence of nitrogen atoms in the pyridine rings. The hydroxyl groups contribute to its solubility in polar solvents and enhance its reactivity, allowing it to engage in hydrogen bonding and serve as a potential ligand for metal ions. The compound may exhibit antioxidant properties and can be involved in various chemical reactions, including oxidation and complexation. Its structural features also suggest potential applications in fields such as catalysis, materials science, and medicinal chemistry. Overall, 2,2'-bipyridine-3,3'-diol is a versatile compound with significant implications in both synthetic and applied chemistry.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-7-3-1-5-11-9(7)10-8(14)4-2-6-12-10/h1-6,13-14H

SMILES: c1cc(c(c2c(cccn2)O)nc1)O

Synonyms:

• 3,3'-Dihydroxy-2,2'-Bipyridine

2,2'-Bipyridine-3,3'-diol

CAS: 36145-03-6

Formula: C₁₀H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA00C5PD

2,2'-Bipyridine-3,3'-diol

CAS: 36145-03-6

2,2'-Bipyridine-3,3'-diol

Purity: 98%

Molecular weight: 188.19g/mol

Ref: 54-OR72683

2,2'-Bipyridine-3,3'-diol

CAS: 36145-03-6

Formula: C₁₀H₈N₂O₂

Purity: >98.0%(GC)

Color and Shape: Yellow - Green Solid Form

Molecular weight: 188.19

Ref: 3B-B4255

3,3'-Dihydroxy-2,2'-bipyridine

CAS: 36145-03-6

3,3'-Dihydroxy-2,2'-bipyridine is a water-soluble drug that has been shown to be cytotoxic. It binds to the hydroxyl group of hemoglobin and prevents it from binding with oxygen. 3,3'-Dihydroxy-2,2'-bipyridine also binds to the cell membrane and enters the cell where it forms a cavity with a chelate ring. The molecule has been shown to have high photophysical properties and can be used in biological studies.

Formula: C₁₀H₈N₂O₂

Purity: Min. 97.5 Area-%

Color and Shape: White Powder

Molecular weight: 188.18 g/mol

Ref: 3D-FD11946

2,2′-BIPYRIDINE-3,3′-DIOL

CAS: 36145-03-6

Purity: 98%

Molecular weight: 188.1860046

Ref: 10-F827662