CymitQuimica logo

CAS 361465-12-5

:

3-methoxy-4-[(2-methylbenzyl)oxy]benzaldehyde

Description:
3-Methoxy-4-[(2-methylbenzyl)oxy]benzaldehyde, with the CAS number 361465-12-5, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a benzaldehyde functional group. This compound features a methoxy (-OCH3) substituent at the 3-position and a 2-methylbenzyl ether group at the 4-position of the benzene ring. The presence of the aldehyde group (-CHO) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, affecting reactivity and stability. Additionally, the bulky 2-methylbenzyl group may impart steric hindrance, which can affect the compound's interactions with other molecules. Overall, this compound may have applications in organic synthesis, medicinal chemistry, and materials science, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C16H16O3
InChI:InChI=1/C16H16O3/c1-12-5-3-4-6-14(12)11-19-15-8-7-13(10-17)9-16(15)18-2/h3-10H,11H2,1-2H3
SMILES:Cc1ccccc1COc1ccc(cc1OC)C=O
Synonyms:
  • Benzaldehyde, 3-Methoxy-4-[(2-Methylphenyl)Methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.