CAS 36148-89-7
:Amphotericin B monomethyl ester
Description:
Amphotericin B monomethyl ester is a derivative of the antifungal agent amphotericin B, which is primarily used to treat serious fungal infections. This compound is characterized by its amphipathic nature, possessing both hydrophilic and hydrophobic properties, which allows it to interact with cell membranes effectively. It exhibits a broad spectrum of antifungal activity, particularly against Candida and Aspergillus species. The monomethyl ester modification enhances its solubility in organic solvents, which can improve its pharmacokinetic properties compared to the parent compound. Amphotericin B monomethyl ester is typically administered intravenously and is known for its potential side effects, including nephrotoxicity and infusion-related reactions. Its mechanism of action involves binding to ergosterol in fungal cell membranes, leading to pore formation and subsequent cell lysis. This compound is of interest in research for its potential applications in treating fungal infections, especially in immunocompromised patients. As with all pharmaceuticals, its use should be carefully monitored to mitigate adverse effects.
Formula:C48H75NO17
InChI:InChI=1/C48H75NO17/c1-28-18-16-14-12-10-8-6-7-9-11-13-15-17-19-35(65-47-45(59)42(49)44(58)31(4)64-47)25-39-41(46(60)62-5)38(55)27-48(61,66-39)26-34(52)22-32(50)20-21-36(53)37(54)23-33(51)24-40(56)63-30(3)29(2)43(28)57/h6-19,28-39,41-45,47,50-55,57-59,61H,20-27,49H2,1-5H3/b7-6-,10-8-,11-9-,14-12-,15-13-,18-16-,19-17-/t28-,29+,30-,31+,32-,33+,34-,35-,36-,37-,38-,39-,41+,42-,43+,44+,45-,47-,48+/m0/s1
InChI key:InChIKey=UAZIZEMIKKIBCA-TYVGYKFWSA-N
SMILES:C(OC)(=O)[C@H]1[C@]2(O[C@@](O)(C[C@@H]1O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](O[C@H]3[C@@H](O)[C@@H](N)[C@H](O)[C@@H](C)O3)C2)[H]
Synonyms:- 14,39-Dioxabicyclo[33.3.1]nonatriacontane, amphotericin B deriv.
- Amphotericin B monomethyl ester
- Amphotericin B, methyl ester
- Methylamphotericin B
- methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate hydrochloride
- methyl (1R,3S,5S,8S,9S,11R,15S,16S,17R,18S,25Z,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,8,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Amphotericin B methyl ester
CAS:<p>Amphotericin B methyl ester: a cholesterol-binding antifungal derivative of Amphotericin B; inhibits HIV-1.</p>Formula:C48H75NO17Purity:98%Color and Shape:SolidMolecular weight:938.118Amphotericin B Methyl Ester 90%
CAS:Controlled Product<p>Applications Amphotericin B Methyl Ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B Methyl Esterin is a cholesterol binding compound that showed inhibiton of human immunodeficiency virus type 1 (HIV-1).<br>References Waheed, A.A. et al.: J. Biol. Chem., 281, 28699 (2006); Waheed, A. et al.: J. Virol., 82, 9776 (2008); Waheed, A., et al.: J. Biol. Chem., 281, 28699 (2006)<br></p>Formula:C49H77NO16Purity:>80%Color and Shape:Dark Yellow To Dark OrangeMolecular weight:936.13Amphotericin B methyl ester
CAS:<p>Amphotericin B is an antifungal agent that belongs to a class of polyenes. It binds to ergosterol in fungal cell membranes and alters their permeability, thereby causing leakage of cellular contents. Amphotericin B methyl ester is a water-soluble prodrug form of amphotericin B that has been shown to have anti-infective activity against many types of fungi, including Candida albicans, Trichosporon beigelii, and Aspergillus fumigatus. Amphotericin B methyl ester has also been shown to be effective against some bacteria such as Streptococcus pneumoniae, Haemophilus influenzae, and Mycoplasma pneumoniae. In vitro studies have demonstrated the detection sensitivity of amphotericin B methyl ester for Coccidioides immitis at 1 ng/ml or less. Amphotericin B methyl ester does not exhibit any hemolytic activity even at concentrations</p>Formula:C48H75NO17Purity:Min. 95%Molecular weight:938.1 g/molRef: 4Z-A-137005
Discontinued product
