CAS 3615-56-3: D-Sorbose
Description:D-Sorbose is a naturally occurring sugar and a ketose monosaccharide, classified as an aldohexose. It is a six-carbon sugar with the molecular formula C6H12O6, and it is structurally related to D-fructose. D-Sorbose is typically found in certain fruits and is known for its sweet taste, although it is less sweet than sucrose. The compound is characterized by its ability to undergo various chemical reactions, including oxidation and reduction, which makes it useful in biochemical applications. D-Sorbose is also utilized in the food industry as a sweetener and in the production of certain pharmaceuticals. Its CAS number, 3615-56-3, is a unique identifier that helps in the classification and regulation of the substance. In terms of physical properties, D-Sorbose is a white crystalline solid that is soluble in water, making it suitable for various applications in both food and chemical industries. Additionally, it has potential health benefits, including its role in metabolic processes.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m1/s1
InChI key:InChIKey=BJHIKXHVCXFQLS-PYWDMBMJSA-N
SMILES:O=C(CO)C(O)C(O)C(O)CO
- Synonyms:
- (-)-Sorbitol
- <span class="text-smallcaps">D</span>-(+)-Sorbose
- <span class="text-smallcaps">D</span>-xylo-2-Hexulose
- D-sorbopyranose
- D-xylo-hex-2-ulose
- Sorbinose
- Sorbose
- Sorbose (VAN)
- Sorbose, <span class="text-smallcaps">D</span>-
- alpha-D-sorbopyranose
- See more synonyms
- beta-D-sorbopyranose
- D-Sorbose
- D-xylo-2-Hexulose
- D-Sorbose
- Sorbose, D-
- D-(+)-Sorbose
