CAS 36155-35-8

2-[(4-chlorophenyl)sulfanyl]ethanaminium

Description:

2-[(4-chlorophenyl)sulfanyl]ethanaminium, with the CAS number 36155-35-8, is a chemical compound characterized by its quaternary ammonium structure, which includes a positively charged nitrogen atom bonded to an ethyl group and a 4-chlorophenylsulfanyl moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in water and organic solvents, and may display antimicrobial activity due to the presence of the chlorophenyl group. The sulfenyl linkage contributes to its reactivity, potentially allowing for interactions with various biological molecules. The presence of the chlorine atom can influence the compound's electronic properties and biological activity. As with many quaternary ammonium compounds, it may also have applications in various fields, including pharmaceuticals, biocides, and surfactants. Safety and handling precautions should be observed, as quaternary ammonium compounds can be toxic and may pose environmental risks.

Formula: C₈H₁₁ClNS

InChI: InChI=1/C8H10ClNS/c9-7-1-3-8(4-2-7)11-6-5-10/h1-4H,5-6,10H2/p+1

SMILES: c1cc(ccc1Cl)SCCN

Synonyms:

• Ethanamine, 2-[(4-Chlorophenyl)Thio]-

2-[(4-Chlorophenyl)sulfanyl]ethan-1-amine

CAS: 36155-35-8

Formula: C₈H₁₀ClNS

Molecular weight: 187.6897

Ref: IN-DA007B88

2-[(4-Chlorophenyl)sulfanyl]ethan-1-amine

CAS: 36155-35-8

2-[(4-Chlorophenyl)sulfanyl]ethan-1-amine

Purity: 95%

Molecular weight: 187.69g/mol

Ref: 54-OR32629